The store will not work correctly when cookies are disabled.
1-(2-Methoxy-6-methylphenyl)ethanone - 98%, high purity , CAS No.6161-64-4
Basic Description
Synonyms | 1-(2-methoxy-6-methylphenyl)ethanone | 6161-64-4 | 2-Methoxy-6-methylacetophenone | 1-(2-methoxy-6-methylphenyl)ethan-1-one | SCHEMBL8261359 | DTXSID80423899 | WCOFWOOVCLIIFJ-UHFFFAOYSA-N | MFCD22068670 | AKOS022176753 | EL-0725 | CS-0153637 | C75893 | EN300-1844704 | A868670 | Q678 |
Specifications & Purity | 98% |
Storage Temp | Room temperature |
Shipped In | Normal |
---|
Names and Identifiers
IUPAC Name | 1-(2-methoxy-6-methylphenyl)ethanone |
INCHI | InChI=1S/C10H12O2/c1-7-5-4-6-9(12-3)10(7)8(2)11/h4-6H,1-3H3 |
InChi Key | WCOFWOOVCLIIFJ-UHFFFAOYSA-N |
Canonical SMILES | CC1=C(C(=CC=C1)OC)C(=O)C |
Isomeric SMILES | CC1=C(C(=CC=C1)OC)C(=O)C |
PubChem CID | 6429092 |
Molecular Weight | 164.2 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator