| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| D120852-50mg | 50mg | In stock | $71.90 | |
| D120852-250mg | 250mg | In stock | $273.90 | |
| D120852-1g | 1g | In stock | $841.90 |
| Synonyms | (3S,4R,5R)-3,4,5,6-tetrahydroxy-1-morpholin-4-ylhexan-2-one | (3S,4R,5R)-3,4,5,6-Tetrahydroxy-1-morpholinohexan-2-one | SCHEMBL3362747 | C16113 | 1-Deoxy-1-morpholino-D-fructose |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Store at -20°C |
| Shipped In | Ice chest + Ice pads |
| Product Description | 1-Deoxy-1-morpholino-D-fructose (DMF), an analog of the 1-desoxy-1-amino-fructose radical found in glycated proteins, is used in the development of glycation assays |
| IUPAC Name | (3S,4R,5R)-3,4,5,6-tetrahydroxy-1-morpholin-4-ylhexan-2-one |
|---|---|
| INCHI | InChI=1S/C10H19NO6/c12-6-8(14)10(16)9(15)7(13)5-11-1-3-17-4-2-11/h8-10,12,14-16H,1-6H2/t8-,9-,10-/m1/s1 |
| InChi Key | JPANQHVKLYKLEB-OPRDCNLKSA-N |
| Canonical SMILES | C1COCCN1CC(=O)C(C(C(CO)O)O)O |
| Isomeric SMILES | C1COCCN1CC(=O)[C@H]([C@@H]([C@@H](CO)O)O)O |
| WGK Germany | 3 |
| PubChem CID | 2728940 |
| Molecular Weight | 249.26 |
Enter Lot Number to search for COA:
| Melt Point(°C) | 147 °C |
|---|
| WGK Germany | 3 |
|---|
I2209305