The store will not work correctly when cookies are disabled.
1H,1H,2H-Perfluoro-1-hexene - 97%, high purity , CAS No.19430-93-4
Basic Description
| Synonyms | 19430-93-4|(Perfluorobutyl)ethylene|3,3,4,4,5,5,6,6,6-Nonafluoro-1-hexene|3,3,4,4,5,5,6,6,6-nonafluorohex-1-ene|Perfluorobutylethylene|1H,1H,2H-Perfluoro-1-hexene|1h,1h,2h-perfluorohexene|(Perfluorobutyl)ethene|1-Hexene, 3,3,4,4,5,5,6,6,6-nonafluoro-|3,3, |
|---|
| Specifications & Purity | 97% |
|---|
| Shipped In | Normal |
|---|
Names and Identifiers
| Pubchem Sid | 488186468 |
|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488186468 |
|---|
| IUPAC Name | 3,3,4,4,5,5,6,6,6-nonafluorohex-1-ene |
|---|
| INCHI | InChI=1S/C6H3F9/c1-2-3(7,8)4(9,10)5(11,12)6(13,14)15/h2H,1H2 |
|---|
| InChi Key | GVEUEBXMTMZVSD-UHFFFAOYSA-N |
|---|
| Canonical SMILES | C=CC(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
|---|
| Isomeric SMILES | C=CC(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
|---|
| WGK Germany | 3 |
|---|
| RTECS | MP7360000 |
|---|
| PubChem CID | 88054 |
|---|
| Molecular Weight | 246.07 |
|---|
| Beilstein | 1819716 |
|---|
| Reaxy-Rn | 1819716 |
|---|
Chemical and Physical Properties
| Refractive Index | 1.289 |
|---|
| Flash Point(°F) | 1.4 °F |
|---|
| Flash Point(°C) | -17°C(Lit.) |
|---|
| Boil Point(°C) | 60°C |
|---|
Safety and Hazards(GHS)
| Pictogram(s) | GHS02 |
|---|
| Signal | Danger |
|---|
| Hazard Statements | H225:Highly Flammable liquid and vapor |
|---|
| Precautionary Statements | P210:Keep away from heat, hot surface, sparks, open flames and other ignition sources. - No smoking. |
|---|
| WGK Germany | 3 |
|---|
| RTECS | MP7360000 |
|---|
| Reaxy-Rn | 1819716 |
|---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator
D2108378