Determine the necessary mass, volume, or concentration for preparing a solution.
Basic Description
| Synonyms | 2,4-DIAMINOANISOLE | 615-05-4 | 4-methoxybenzene-1,3-diamine | 4-Methoxy-m-phenylenediamine | 2,4-Diaminoanisol | 1,3-Benzenediamine, 4-methoxy- | Pelagol L | Pelagol DA | Pelagol Grey L | Furro L | Anisole, 2,4-diamino- | 2,4-Diamineanisole | 4-Methoxy-1,3-benzenediamine | 2,4-Di |
|---|---|
| Specifications & Purity | 100mg/L in methanol |
| Shipped In | Normal |
Names and Identifiers
| IUPAC Name | 4-methoxybenzene-1,3-diamine |
|---|---|
| INCHI | InChI=1S/C7H10N2O/c1-10-7-3-2-5(8)4-6(7)9/h2-4H,8-9H2,1H3 |
| InChi Key | BAHPQISAXRFLCL-UHFFFAOYSA-N |
| Canonical SMILES | COC1=C(C=C(C=C1)N)N |
| Isomeric SMILES | COC1=C(C=C(C=C1)N)N |
| WGK Germany | 3 |
| RTECS | BZ8580500 |
| PubChem CID | 11976 |
| UN Number | 2811 |
| Packing Group | I |
| Molecular Weight | 138.17 |
| Beilstein | 2085522 |
Certificates
Certificate of Analysis(COA)
Enter Lot Number to search for COA:
Chemical and Physical Properties
| Sensitivity | Light Sensitive |
|---|
Safety and Hazards(GHS)
| Pictogram(s) | GHS08, GHS09, GHS07 |
|---|---|
| Signal | Danger |
| Hazard Statements | H341:Suspected of causing genetic defects H411:Toxic to aquatic life with long lasting effects H302:Harmful if swallowed H350:May cause cancer |
| Precautionary Statements | P273:Avoid release to the environment. P280:Wear protective gloves/protective clothing/eye protection/face protection. P405:Store locked up. P501:Dispose of contents/container to ... P264:Wash hands [and …] thoroughly after handling. P281:Use personal protective equipment as required. P270:Do not eat, drink or smoke when using this product. P391:Collect spillage. P330:Rinse mouth. P203:Obtain, read and follow all safety instructions before use. P301+P317:IF SWALLOWED: Get medical help. P318:if exposed or concerned, get medical advice. |
| WGK Germany | 3 |
| RTECS | BZ8580500 |
| Class | 6.1 |