| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| A637952-1g | 1g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $801.90 |
| Synonyms | 218779-77-2;2-(4-(ethoxycarbonyl)cyclohexyl)acetic acid;[4-(ethoxycarbonyl)cyclohexyl]acetic acid;2-(4-ethoxycarbonylcyclohexyl)acetic acid;4-Carboxymethyl-cyclohexanecarboxylic acid ethyl ester;4-(Ethoxycarbonyl)-cyclohexaneacetic acid;2-[4-(ethoxycarbon |
|---|---|
| Specifications & Purity | 97% |
| Shipped In | Normal |
| IUPAC Name | 2-(4-ethoxycarbonylcyclohexyl)acetic acid |
|---|---|
| INCHI | InChI=1S/C11H18O4/c1-2-15-11(14)9-5-3-8(4-6-9)7-10(12)13/h8-9H,2-7H2,1H3,(H,12,13) |
| InChi Key | PUZVRPZVVLUGOJ-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C1CCC(CC1)CC(=O)O |
| Isomeric SMILES | CCOC(=O)C1CCC(CC1)CC(=O)O |
| PubChem CID | 15896192 |
| Molecular Weight | 214.26 |
Enter Lot Number to search for COA:
| Pictogram(s) | GHS07 |
|---|---|
| Signal | Warning |
| Hazard Statements | H302 |
| Precautionary Statements | P501,P264,P270,P330,P301+P312 |
