| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| D290467-250mg | 250mg | In stock | $90.90 | |
| D290467-1g | 1g | In stock | $306.90 | |
| D290467-5g | 5g | In stock | $1,264.90 |
| Specifications & Purity | ≥98% |
|---|
| Pubchem Sid | 488201274 |
|---|---|
| IUPAC Name | 2,9-dichloro-4,7-diphenyl-1,10-phenanthroline |
| INCHI | InChI=1S/C24H14Cl2N2/c25-21-13-19(15-7-3-1-4-8-15)17-11-12-18-20(16-9-5-2-6-10-16)14-22(26)28-24(18)23(17)27-21/h1-14H |
| InChi Key | ILQFTFBKMWFBPG-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=CC(=NC3=C2C=CC4=C3N=C(C=C4C5=CC=CC=C5)Cl)Cl |
| Isomeric SMILES | C1=CC=C(C=C1)C2=CC(=NC3=C2C=CC4=C3N=C(C=C4C5=CC=CC=C5)Cl)Cl |
| PubChem CID | 46240522 |
Enter Lot Number to search for COA:
| Pictogram(s) | GHS07 |
|---|---|
| Signal | Warning |
| Hazard Statements | H302:Harmful if swallowed |
| Precautionary Statements | P305+P351+P338:IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses if present and easy to do - continue rinsing. P280:Wear protective gloves/protective clothing/eye protection/face protection. |
F2225145