The store will not work correctly when cookies are disabled.
2-Benzylamino-5-bromopyrimidine - 98%, high purity , CAS No.38373-55-6
Basic Description
Synonyms | N-benzyl-5-bromopyrimidin-2-amine | 38373-55-6 | 2-BENZYLAMINO-5-BROMOPYRIMIDINE | SCHEMBL1395088 | DTXSID80408686 | SEJMYSXXRMYOGT-UHFFFAOYSA-N | benzyl-(5-bromopyrimidin-2-yl)amine | MFCD00483264 | AKOS013188470 | AB06312 | BS-28283 | CS-0193734 | BENZYL-(5-BROMO-PYRIMIDIN-2-Y |
Specifications & Purity | 98% |
Storage Temp | Room temperature |
Shipped In | Normal |
---|
Names and Identifiers
IUPAC Name | N-benzyl-5-bromopyrimidin-2-amine |
INCHI | InChI=1S/C11H10BrN3/c12-10-7-14-11(15-8-10)13-6-9-4-2-1-3-5-9/h1-5,7-8H,6H2,(H,13,14,15) |
InChi Key | SEJMYSXXRMYOGT-UHFFFAOYSA-N |
Canonical SMILES | C1=CC=C(C=C1)CNC2=NC=C(C=N2)Br |
Isomeric SMILES | C1=CC=C(C=C1)CNC2=NC=C(C=N2)Br |
PubChem CID | 5139142 |
Molecular Weight | 264.1 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator