| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| D337246-3.4mg | 3.4mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $99.90 |
| Synonyms | 93839-95-3|EINECS 298-869-6|Adenosine, 2'-deoxy-, cyclic 3',5'-(hydrogen phosphate), monosodium salt|2'-Dcamp sodium salt|2'-deoxy-3':5'-cAMP|2'-Deoxyadenosine 3':5'-cyclic monophosphate sodium salt|DTXSID90917618|Adenosine,2'-deoxy-,cyclic 3',5'-(hydroge |
|---|---|
| Storage Temp | Store at -20°C |
| Shipped In | Ice chest + Ice pads |
| IUPAC Name | sodium;9-[(4aR,6R,7aS)-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]purin-6-amine |
|---|---|
| INCHI | InChI=1S/C10H12N5O5P.Na/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5-6(19-7)2-18-21(16,17)20-5;/h3-7H,1-2H2,(H,16,17)(H2,11,12,13);/q;+1/p-1/t5-,6+,7+;/m0./s1 |
| InChi Key | ASTSMWVPJUMNPE-VWZUFWLJSA-M |
| Canonical SMILES | C1C2C(COP(=O)(O2)[O-])OC1N3C=NC4=C(N=CN=C43)N.[Na+] |
| Isomeric SMILES | C1[C@H]2[C@@H](COP(=O)(O2)[O-])O[C@H]1N3C=NC4=C(N=CN=C43)N.[Na+] |
| PubChem CID | 44755072 |
| Molecular Weight | 335.19 |
Enter Lot Number to search for COA:
