The store will not work correctly when cookies are disabled.
2′-Deoxyadenosine 5′-monophosphate monohydrate , CAS No.207127-57-9
Basic Description
Synonyms | 2'-Deoxyadenosine 5'-monophosphate monohydrate|207127-57-9|[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate;hydrate|((2R,3S,5R)-5-(6-Amino-9h-purin-9-yl)-3-hydroxytetrahydrofuran-2-yl)methyl dihydrogen phosphate hydrate|S |
Storage Temp | Room temperature |
Shipped In | Normal |
---|
Names and Identifiers
IUPAC Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate;hydrate |
INCHI | InChI=1S/C10H14N5O6P.H2O/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(21-7)2-20-22(17,18)19;/h3-7,16H,1-2H2,(H2,11,12,13)(H2,17,18,19);1H2/t5-,6+,7+;/m0./s1 |
InChi Key | QQMAPZSBBNPXKS-VWZUFWLJSA-N |
Canonical SMILES | C1C(C(OC1N2C=NC3=C(N=CN=C32)N)COP(=O)(O)O)O.O |
Isomeric SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)COP(=O)(O)O)O.O |
WGK Germany | 3 |
PubChem CID | 16218593 |
Molecular Weight | 349.24 |
---|
Chemical and Physical Properties
Melt Point(°C) | 148° C (lit.) |
---|
Safety and Hazards(GHS)
WGK Germany | 3 |
RIDADR | NONHforallmodesoftransport |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator