| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| N472389-5g | 5g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $121.90 |
| Synonyms | 305808-24-6 | calcium naphthalen-2-yl phosphate | 2-Naphthyl phosphate calcium salt hydrate | 2-Naphthalenol, dihydrogen phosphate, calcium salt | 71436-98-1 | Calcium 2-naphthyl phosphate | CALCIUM 2-NAPHTHYLPHOSPHATE | EINECS 275-457-4 | SCHEMBL2963773 | DTXSID10221628 | E |
|---|---|
| Specifications & Purity | 98% |
| Storage Temp | Store at 2-8°C |
| Shipped In | Wet ice |
| IUPAC Name | calcium;naphthalen-2-yl phosphate |
|---|---|
| INCHI | InChI=1S/C10H9O4P.Ca/c11-15(12,13)14-10-6-5-8-3-1-2-4-9(8)7-10;/h1-7H,(H2,11,12,13);/q;+2/p-2 |
| InChi Key | MPIBXADBMJKANU-UHFFFAOYSA-L |
| Canonical SMILES | C1=CC=C2C=C(C=CC2=C1)OP(=O)([O-])[O-].[Ca+2] |
| Isomeric SMILES | C1=CC=C2C=C(C=CC2=C1)OP(=O)([O-])[O-].[Ca+2] |
| WGK Germany | 3 |
| PubChem CID | 6098389 |
Enter Lot Number to search for COA:
| WGK Germany | 3 |
|---|---|
| RIDADR | NONHforallmodesoftransport |
