| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| T354775-1g | 1g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $825.90 |
| Synonyms | J-013462 | 2-(thiophen-3-yl)benzoicacid | F2167-0760 | 2-thiophen-3-yl benzoic acid | FRQNAMNFPWSQAW-UHFFFAOYSA-N | FS-1983 | 2-(3-thienyl)benzoic acid | 2-(thiophen-3-yl)benzoic acid | CS-0269544 | Benzoic acid, 2-(3-thienyl)- | BB 0223653 | DTXSID604283 |
|---|---|
| Shipped In | Normal |
| IUPAC Name | 2-thiophen-3-ylbenzoic acid |
|---|---|
| INCHI | InChI=1S/C11H8O2S/c12-11(13)10-4-2-1-3-9(10)8-5-6-14-7-8/h1-7H,(H,12,13) |
| InChi Key | FRQNAMNFPWSQAW-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C(=C1)C2=CSC=C2)C(=O)O |
| Isomeric SMILES | C1=CC=C(C(=C1)C2=CSC=C2)C(=O)O |
| PubChem CID | 7176503 |
| Molecular Weight | 204.24 |
Enter Lot Number to search for COA:
| Refractive Index | n20D1.64 (Predicted) |
|---|---|
| Boil Point(°C) | ~315.5° C at 760 mmHg (Predicted) |
| Melt Point(°C) | 139.74° C (Predicted) |
