| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| O352468-250mg | 250mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $117.90 |
| Synonyms | 3-oxopentanenitrile | 33279-01-5 | 3- Oxopentanenitrile | 3-Oxo-Pentanenitrile | MFCD07367087 | Pentanenitrile, 3-oxo- | Propionylacetonitrile | 1-Cyanobutan-2-one | cyanobutanone | 2-butanone cyanide | 3-Oxopentanonitrile | DTXSID90432770 | KOYWUYIBEXFRFH-UHFFFAOYSA-N | AMY10591 | |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
| IUPAC Name | 3-oxopentanenitrile |
|---|---|
| INCHI | InChI=1S/C5H7NO/c1-2-5(7)3-4-6/h2-3H2,1H3 |
| InChi Key | KOYWUYIBEXFRFH-UHFFFAOYSA-N |
| Canonical SMILES | CCC(=O)CC#N |
| Isomeric SMILES | CCC(=O)CC#N |
| PubChem CID | 9920369 |
| Molecular Weight | 97.12 |
Enter Lot Number to search for COA:
| Refractive Index | n20D1.41 (Predicted) |
|---|---|
| Boil Point(°C) | 146.09° C at 760 mmHg (Predicted) |
| Melt Point(°C) | 27-30° C |
