The store will not work correctly when cookies are disabled.
3-Phenoxytoluene - 98%, high purity , CAS No.3586-14-9
Basic Description
| Synonyms | 3-Phenoxytoluene | 1-Methyl-3-phenoxybenzene | 3586-14-9 | m-Phenoxytoluene | 3-Methyldiphenyl ether | Phenyl m-tolyl ether | Ether, phenyl m-tolyl | m-Methylphenyl phenyl ether | BENZENE, 1-METHYL-3-PHENOXY- | 3-Methylphenyl phenyl ether | MFCD00008531 | 1-methyl-3-phenoxy-be |
|---|
| Specifications & Purity | ≥98% |
|---|
| Storage Temp | Argon charged |
|---|
| Shipped In | Normal |
|---|
Names and Identifiers
| Pubchem Sid | 488182529 |
|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488182529 |
|---|
| IUPAC Name | 1-methyl-3-phenoxybenzene |
|---|
| INCHI | InChI=1S/C13H12O/c1-11-6-5-9-13(10-11)14-12-7-3-2-4-8-12/h2-10H,1H3 |
|---|
| InChi Key | UDONPJKEOAWFGI-UHFFFAOYSA-N |
|---|
| Canonical SMILES | CC1=CC(=CC=C1)OC2=CC=CC=C2 |
|---|
| Isomeric SMILES | CC1=CC(=CC=C1)OC2=CC=CC=C2 |
|---|
| WGK Germany | 2 |
|---|
| RTECS | DA6142000 |
|---|
| PubChem CID | 19165 |
|---|
| Molecular Weight | 184.24 |
|---|
| Beilstein | 2045710 |
|---|
| Reaxy-Rn | 2045714 |
|---|
Chemical and Physical Properties
| Sensitivity | air sensitive |
|---|
| Refractive Index | 1.57 |
|---|
| Flash Point(°F) | 235.4 °F |
|---|
| Flash Point(°C) | 113 °C |
|---|
| Boil Point(°C) | 272 °C |
|---|
Safety and Hazards(GHS)
| Pictogram(s) | GHS09 |
|---|
| Hazard Statements | H411:Toxic to aquatic life with long lasting effects |
|---|
| Precautionary Statements | P273:Avoid release to the environment. |
|---|
| WGK Germany | 2 |
|---|
| RTECS | DA6142000 |
|---|
| Reaxy-Rn | 2045714 |
|---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator
H2012001