| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| H351500-10mg | 10mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $266.90 |
| Synonyms | NSC-132373 | STK043561 | HY-100084 | CS-0018061 | IMNIZYXAQQBADI-OZECAXSSSA-N | 3beta-hydroxy-5-cholenic acid methyl ester | AOMB | 3b-hydroxychol-5-en-24-oic acid methyl ester | AKOS015955531 | Methyl-3 | UNII-6ZLS7I6QFI | 3 | BDBM20191 | E87621 | Chol-5 |
|---|---|
| Shipped In | Normal |
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | methyl (4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| INCHI | InChI=1S/C25H40O3/c1-16(5-10-23(27)28-4)20-8-9-21-19-7-6-17-15-18(26)11-13-24(17,2)22(19)12-14-25(20,21)3/h6,16,18-22,26H,5,7-15H2,1-4H3/t16-,18+,19+,20-,21+,22+,24+,25-/m1/s1 |
| InChi Key | IMNIZYXAQQBADI-OZECAXSSSA-N |
| Canonical SMILES | CC(CCC(=O)OC)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C |
| Isomeric SMILES | C[C@H](CCC(=O)OC)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C |
| PubChem CID | 11153463 |
| Molecular Weight | 388.58 |
Enter Lot Number to search for COA:
