| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| A355169-250mg | 250mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $577.90 |
a specific substrate for rat arylsulfatase C
| Synonyms | SCHEMBL1712873 | EINECS 253-988-2 | p-Acetylphenyl sulfate potassium salt | DTXSID00191861 | potassium;(4-acetylphenyl) sulfate | FT-0639479 | Potassium p-acetylphenyl sulphate | potassium 4-acetylphenyl sulfate |
|---|---|
| Storage Temp | Store at -20°C |
| Shipped In | Ice chest + Ice pads |
| Product Description | 4-Acetylphenyl sulfate potassium salt is a specific substrate for rat arylsulfatase C. |
| IUPAC Name | potassium;(4-acetylphenyl) sulfate |
|---|---|
| INCHI | InChI=1S/C8H8O5S.K/c1-6(9)7-2-4-8(5-3-7)13-14(10,11)12;/h2-5H,1H3,(H,10,11,12);/q;+1/p-1 |
| InChi Key | ROAAZPXPHLVGPY-UHFFFAOYSA-M |
| Canonical SMILES | CC(=O)C1=CC=C(C=C1)OS(=O)(=O)[O-].[K+] |
| Isomeric SMILES | CC(=O)C1=CC=C(C=C1)OS(=O)(=O)[O-].[K+] |
| WGK Germany | 3 |
| PubChem CID | 23679874 |
| Molecular Weight | 254.3 |
Enter Lot Number to search for COA:
| WGK Germany | 3 |
|---|
