| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| A304090-250mg | 250mg | In stock | $103.90 | |
| A304090-1g | 1g | In stock | $344.90 |
| Synonyms | 4-Aminophthalide | 59434-19-4 | 4-aminoisobenzofuran-1(3H)-one | 4-AMINO-3H-2-BENZOFURAN-1-ONE | 4-amino-1,3-dihydro-2-benzofuran-1-one | MFCD04117950 | 4-amino-3H-isobenzofuran-1-one | 4-amino-phthalide | SCHEMBL2045834 | DTXSID30484374 | KOIAVJZQMYBLJJ-UHFFFAOYSA-N | 4-amino |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Store at 2-8°C,Protected from light,Desiccated |
| Shipped In | Wet ice |
| IUPAC Name | 4-amino-3H-2-benzofuran-1-one |
|---|---|
| INCHI | InChI=1S/C8H7NO2/c9-7-3-1-2-5-6(7)4-11-8(5)10/h1-3H,4,9H2 |
| InChi Key | KOIAVJZQMYBLJJ-UHFFFAOYSA-N |
| Canonical SMILES | C1C2=C(C=CC=C2N)C(=O)O1 |
| Isomeric SMILES | C1C2=C(C=CC=C2N)C(=O)O1 |
| PubChem CID | 12284649 |
| Molecular Weight | 149.14 |
Enter Lot Number to search for COA:
| Flash Point(°C) | 241.528°C |
|---|---|
| Boil Point(°C) | 411°C at 760 mmHg |
| Melt Point(°C) | 154-155°C |
| Pictogram(s) | GHS07 |
|---|---|
| Signal | Warning |
| Hazard Statements | H315:Causes skin irritation H319:Causes serious eye irritation H335:May cause respiratory irritation H302:Harmful if swallowed |
| Precautionary Statements | P261:Avoid breathing dust/fume/gas/mist/vapors/spray. P305+P351+P338:IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses if present and easy to do - continue rinsing. |
I2101119