| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| A337270-1g | 1g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $237.90 |
| Synonyms | DTXSID50212994 | EINECS 228-836-3 | FT-0610929 | 6-Acetamido-4-hydroxynaphthalene-2-sulphonic acid | W-104893 | 6-acetamido-4-hydroxy-2-naphthalenesulfonic acid | 2-Acetamido-8-naphthol-6-sufonic acid (N-acetyl gamma acid) | 2-Acetamido-8-naphthol-6-sufon |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
| IUPAC Name | 6-acetamido-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| INCHI | InChI=1S/C12H11NO5S/c1-7(14)13-9-3-2-8-4-10(19(16,17)18)6-12(15)11(8)5-9/h2-6,15H,1H3,(H,13,14)(H,16,17,18) |
| InChi Key | YKVBYISUDGOVDM-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)NC1=CC2=C(C=C(C=C2C=C1)S(=O)(=O)O)O |
| Isomeric SMILES | CC(=O)NC1=CC2=C(C=C(C=C2C=C1)S(=O)(=O)O)O |
| PubChem CID | 80706 |
| Molecular Weight | 281.28 |
Enter Lot Number to search for COA:
