| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| B331001-25mg | 25mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $266.90 |
| Synonyms | 6-BROMOHEXYLTRIETHYLAMMONIUM BROMIDE | 161097-76-3 | 6-bromohexyl(triethyl)azanium;bromide | 6-Bromo-N,N,N-triethyl-1-hexanaminium Bromide | 1-Hexanaminium, 6-bromo-N,N,N-triethyl-, bromide (1:1) | DTXSID50675727 | AKOS025294638 | FT-0663749 | 6-Bromo-N,N,N-triethylhexan |
|---|---|
| Storage Temp | Store at 2-8°C |
| Shipped In | Wet ice |
| IUPAC Name | 6-bromohexyl(triethyl)azanium;bromide |
|---|---|
| INCHI | InChI=1S/C12H27BrN.BrH/c1-4-14(5-2,6-3)12-10-8-7-9-11-13;/h4-12H2,1-3H3;1H/q+1;/p-1 |
| InChi Key | SUPZNVBPHMFWPG-UHFFFAOYSA-M |
| Canonical SMILES | CC[N+](CC)(CC)CCCCCCBr.[Br-] |
| Isomeric SMILES | CC[N+](CC)(CC)CCCCCCBr.[Br-] |
| PubChem CID | 46780898 |
| Molecular Weight | 345.16 |
Enter Lot Number to search for COA:
| Solubility | Soluble in DMSO |
|---|
