| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| O351640-250mg | 250mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $119.90 |
| Synonyms | 6-O-tert-Butyldimethylsilyl glucal | 6-O-tert-butyldimethylsilyl-D-glucal | MFCD09756139 | SCHEMBL1578986 | HYSBQWOHQIVUQQ-MXWKQRLJSA-N | 6-O-(tert-Butyldimethylsilyl)-D-glucal | (2R,3S,4R)-2-(((tert-Butyldimethylsilyl)oxy)methyl)-3,4-dihydro-2H-pyran-3,4 |
|---|---|
| Storage Temp | Store at -20°C |
| Shipped In | Ice chest + Ice pads |
| IUPAC Name | (2R,3S,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-3,4-diol |
|---|---|
| INCHI | InChI=1S/C12H24O4Si/c1-12(2,3)17(4,5)16-8-10-11(14)9(13)6-7-15-10/h6-7,9-11,13-14H,8H2,1-5H3/t9-,10-,11+/m1/s1 |
| InChi Key | HYSBQWOHQIVUQQ-MXWKQRLJSA-N |
| Canonical SMILES | CC(C)(C)[Si](C)(C)OCC1C(C(C=CO1)O)O |
| Isomeric SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@H]([C@@H](C=CO1)O)O |
| PubChem CID | 11021628 |
| Molecular Weight | 260.4 |
Enter Lot Number to search for COA:
