The store will not work correctly when cookies are disabled.
α-Cellulose - particle size:90um, high purity
Basic Description
Synonyms | cellulose|DEAE-CELLULOSE|9004-34-6|(6S)-2-(hydroxymethyl)-6-[(3S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol|Diethylaminoethyl cellulose|Cellulosepulver|DEAE-Sephacel(R)|Diethylaminoethyl-Sephacel(R)|CHEBI:156274|AKOS015895024|EN300- |
Specifications & Purity | particle size:90um |
Shipped In | Normal |
---|
Names and Identifiers
IUPAC Name | (6S)-2-(hydroxymethyl)-6-[(3S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
INCHI | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3?,4?,5?,6?,7?,8?,9?,10-,11?,12+/m1/s1 |
InChi Key | GUBGYTABKSRVRQ-WFVLMXAXSA-N |
Isomeric SMILES | C(C1[C@H](C(C(C(O1)O)O)O)O[C@H]2C(C(C(C(O2)CO)O)O)O)O |
WGK Germany | 3 |
RTECS | FJ5691460 |
PubChem CID | 16211032 |
---|
Chemical and Physical Properties
Sensitivity | Moisture sensitive. |
Safety and Hazards(GHS)
WGK Germany | 3 |
RTECS | FJ5691460 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator