| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| A424167-1ml | 1ml | Available within 4-8 weeks(?) Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience! | $241.90 |
| Synonyms | Aucubin|479-98-1|Aucuboside|rhinanthin|UNII-2G52GS8UML|EINECS 207-540-8|2G52GS8UML|NSC 407293|Rhimantin|CHEBI:69796|1,4a,5,7a-Tetrahydro-5-hydroxy-7-hydroxymethylcyclopenta(c)pyran-1-yl-beta-D-glucopyranoside|NSC-407293|(1S,4aR,5S,7aS)-1,4a,5,7a-Tetrahydr |
|---|---|
| Specifications & Purity | 10mM in DMSO |
| Storage Temp | Store at -80°C |
| Shipped In | Dry ice |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[[(1S,4aR,5S,7aS)-5-hydroxy-7-(hydroxymethyl)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-1-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| INCHI | InChI=1S/C15H22O9/c16-4-6-3-8(18)7-1-2-22-14(10(6)7)24-15-13(21)12(20)11(19)9(5-17)23-15/h1-3,7-21H,4-5H2/t7-,8+,9+,10+,11+,12-,13+,14-,15-/m0/s1 |
| InChi Key | RJWJHRPNHPHBRN-FKVJWERZSA-N |
| Canonical SMILES | C1=COC(C2C1C(C=C2CO)O)OC3C(C(C(C(O3)CO)O)O)O |
| Isomeric SMILES | C1=CO[C@H]([C@H]2[C@@H]1[C@@H](C=C2CO)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
| WGK Germany | 3 |
| PubChem CID | 91458 |
| Molecular Weight | 346.33 |
| Beilstein | 50340 |
Enter Lot Number to search for COA:
| Pictogram(s) | GHS07 |
|---|---|
| Signal | Warning |
| Hazard Statements | H302 |
| Precautionary Statements | P501,P264,P270,P330,P301+P317 |
| WGK Germany | 3 |
