| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| A353778-2.5mg | 2.5mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $813.90 |
| Synonyms | 3-Hydroxypropyl N,N-bis(2-chloroethyl)phosphorodiamidate | NSC 153182 | SCHEMBL12937643 | Phosphorodiamidic acid, N,N-bis(2-chloroethyl)-, 3-hydroxypropyl ester | 3-[amino-[bis(2-chloroethyl)amino]phosphoryl]oxypropan-1-ol | CHEBI:80559 | NSC227248 | NSC- |
|---|---|
| Shipped In | Normal |
| IUPAC Name | 3-[amino-[bis(2-chloroethyl)amino]phosphoryl]oxypropan-1-ol |
|---|---|
| INCHI | InChI=1S/C7H17Cl2N2O3P/c8-2-4-11(5-3-9)15(10,13)14-7-1-6-12/h12H,1-7H2,(H2,10,13) |
| InChi Key | BZGFIGVSVQRQBJ-UHFFFAOYSA-N |
| Canonical SMILES | C(CO)COP(=O)(N)N(CCCl)CCCl |
| Isomeric SMILES | C(CO)COP(=O)(N)N(CCCl)CCCl |
| PubChem CID | 98612 |
| Molecular Weight | 279.1 |
Enter Lot Number to search for COA:
