| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| A120639-100g | 100g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $384.90 |
| Synonyms | AMPSO sodium salt|102029-60-7|1-Propanesulfonic acid, 2-hydroxy-3-[(2-hydroxy-1,1-dimethylethyl)amino]-, sodium salt (1:1)|sodium;2-hydroxy-3-[(1-hydroxy-2-methylpropan-2-yl)amino]propane-1-sulfonate|sodium 2-hydroxy-3-[(1-hydroxy-2-methylpropan-2-yl)amin |
|---|---|
| Specifications & Purity | 98% |
| Shipped In | Normal |
| IUPAC Name | sodium;2-hydroxy-3-[(1-hydroxy-2-methylpropan-2-yl)amino]propane-1-sulfonate |
|---|---|
| INCHI | InChI=1S/C7H17NO5S.Na/c1-7(2,5-9)8-3-6(10)4-14(11,12)13;/h6,8-10H,3-5H2,1-2H3,(H,11,12,13);/q;+1/p-1 |
| InChi Key | UVGYCHPTWHWEPZ-UHFFFAOYSA-M |
| Canonical SMILES | CC(C)(CO)NCC(CS(=O)(=O)[O-])O.[Na+] |
| Isomeric SMILES | CC(C)(CO)NCC(CS(=O)(=O)[O-])O.[Na+] |
| WGK Germany | 3 |
| PubChem CID | 44119996 |
| Molecular Weight | 249.26 |
Enter Lot Number to search for COA:
| WGK Germany | 3 |
|---|
