Determine the necessary mass, volume, or concentration for preparing a solution.
Basic Description
| Synonyms | Auraptene|Aurapten|495-02-3|7-Geranyloxycoumarin|F79I1ZEL2E|7-[(2E)-3,7-dimethylocta-2,6-dienoxy]chromen-2-one|(E)-7-((3,7-Dimethylocta-2,6-dien-1-yl)oxy)-2H-chromen-2-one|2H-1-Benzopyran-2-one, 7-((3,7-dimethyl-2,6-octadienyl)oxy)-, (E)-|7-{[(2E)-3,7-dim |
|---|---|
| Specifications & Purity | 10mM in DMSO |
| Storage Temp | Store at -80°C |
| Shipped In | Dry ice |
| Product Description | Auraptene (7-geranyloxycoumarin) is a prenyloxycoumarin, that is abundantly present in nature. It is produced by several plant species, such as Rutaceae and Umbeliferae (Apiaceae) families |
Names and Identifiers
| IUPAC Name | 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]chromen-2-one |
|---|---|
| INCHI | InChI=1S/C19H22O3/c1-14(2)5-4-6-15(3)11-12-21-17-9-7-16-8-10-19(20)22-18(16)13-17/h5,7-11,13H,4,6,12H2,1-3H3/b15-11+ |
| InChi Key | RSDDHGSKLOSQFK-RVDMUPIBSA-N |
| Canonical SMILES | CC(=CCCC(=CCOC1=CC2=C(C=C1)C=CC(=O)O2)C)C |
| Isomeric SMILES | CC(=CCC/C(=C/COC1=CC2=C(C=C1)C=CC(=O)O2)/C)C |
| WGK Germany | 3 |
| RTECS | MD6500000 |
| PubChem CID | 1550607 |
| Molecular Weight | 298.38 |
Certificates
Certificate of Analysis(COA)
Enter Lot Number to search for COA:
Chemical and Physical Properties
| Sensitivity | heat sensitive |
|---|---|
| Melt Point(°C) | 66°C |
Safety and Hazards(GHS)
| Pictogram(s) | GHS06, GHS08 |
|---|---|
| Signal | Danger |
| Hazard Statements | H301:Toxic if swallowed H361:Suspected of damaging fertility or the unborn child |
| Precautionary Statements | P301+P310:IF SWALLOWED: Immediately call a POISON CENTER/doctor/... P281:Use personal protective equipment as required. |
| WGK Germany | 3 |
| RTECS | MD6500000 |