| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| B168822-1g | 1g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $190.90 |
| Synonyms | MFCD06800382 | (3-butoxyphenyl)amine | 3-butoxyaniline | (3-Butoxyphenyl)amine, AldrichCPR | a-(3-(2-Furoylureido))phenylaceticacid | FT-0683458 | AKOS000104365 | DTXSID30482133 | SCHEMBL109886 | AB01328218-02 | CS-0297752 | BS-35852 | NCGC00333211-01 | S |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
| IUPAC Name | 3-butoxyaniline |
|---|---|
| INCHI | InChI=1S/C10H15NO/c1-2-3-7-12-10-6-4-5-9(11)8-10/h4-6,8H,2-3,7,11H2,1H3 |
| InChi Key | ZIZHOYOBASUITD-UHFFFAOYSA-N |
| Canonical SMILES | CCCCOC1=CC=CC(=C1)N |
| Isomeric SMILES | CCCCOC1=CC=CC(=C1)N |
| PubChem CID | 12244645 |
| Molecular Weight | 165.23 |
Enter Lot Number to search for COA:
| Hazard Statements | H302:Harmful if swallowed |
|---|
