| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| B343869-50mg | 50mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $364.90 |
| Synonyms | Benzaldehyde,4-[2-[4-(dioctylamino)phenyl]diazenyl]-3-nitro- | DTXSID60585040 | 4-[[4-(dioctylamino)phenyl]diazenyl]-3-nitrobenzaldehyde | 4-{(E)-[4-(Dioctylamino)phenyl]diazenyl}-3-nitrobenzaldehyde | SCHEMBL23832053 | Bisulfite ionophore | Bisulfite ion |
|---|---|
| Shipped In | Normal |
| Product Description | Chromoionophore for the selective detection of HSO3- which changes color from pink to orange in the presence of bisulfite (formation of aldehyde sulfoxylate). |
| IUPAC Name | 4-[[4-(dioctylamino)phenyl]diazenyl]-3-nitrobenzaldehyde |
|---|---|
| INCHI | InChI=1S/C29H42N4O3/c1-3-5-7-9-11-13-21-32(22-14-12-10-8-6-4-2)27-18-16-26(17-19-27)30-31-28-20-15-25(24-34)23-29(28)33(35)36/h15-20,23-24H,3-14,21-22H2,1-2H3 |
| InChi Key | GOBXXSMKFPJVEM-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCCN(CCCCCCCC)C1=CC=C(C=C1)N=NC2=C(C=C(C=C2)C=O)[N+](=O)[O-] |
| Isomeric SMILES | CCCCCCCCN(CCCCCCCC)C1=CC=C(C=C1)N=NC2=C(C=C(C=C2)C=O)[N+](=O)[O-] |
| WGK Germany | 3 |
| PubChem CID | 16218807 |
| Molecular Weight | 494.67 |
Enter Lot Number to search for COA:
| WGK Germany | 3 |
|---|---|
| RIDADR | NONHforallmodesoftransport |
