| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| B152871-5ml | 5ml | In stock | $21.90 | |
| B152871-25ml | 25ml | In stock | $81.90 | |
| B152871-100ml | 100ml | Available within 4-8 weeks(?) Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience! | $294.90 |
| Synonyms | BRN 1761408 | ACETOACETIC ACID N-BUTYL ESTER | Butyl 3-oxobutanoate | ethyl-2-ethyl acetoacetate | BUTYL ACETOACETATE [FHFI] | 3-oxo-butyric acid butyl ester | 1-butyl acetoacetate | AKOS003808394 | NSC97211 | NSC-97211 | Acetoacetic Acid Butyl Ester | 2W |
|---|---|
| Specifications & Purity | ≥96% |
| Shipped In | Normal |
| Pubchem Sid | 488181386 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488181386 |
| IUPAC Name | butyl 3-oxobutanoate |
| INCHI | InChI=1S/C8H14O3/c1-3-4-5-11-8(10)6-7(2)9/h3-6H2,1-2H3 |
| InChi Key | REIYHFWZISXFKU-UHFFFAOYSA-N |
| Canonical SMILES | CCCCOC(=O)CC(=O)C |
| Isomeric SMILES | CCCCOC(=O)CC(=O)C |
| RTECS | AK5100000 |
| PubChem CID | 11576 |
| Molecular Weight | 158.2 |
| Beilstein | 3(4)1536 |
| Reaxy-Rn | 1761408 |
Enter Lot Number to search for COA:
| Refractive Index | 1.43 |
|---|---|
| Flash Point(°C) | 85°C(lit.) |
| Boil Point(°C) | 214 °C |
| RTECS | AK5100000 |
|---|---|
| Reaxy-Rn | 1761408 |
E2330177