The store will not work correctly when cookies are disabled.
Butyl chlorofluoroacetate , CAS No.368-34-3
Basic Description
Synonyms | DTXSID30378461 | butyl 2-chloro-2-fluoroacetate | AKOS006228620 | Butyl chlorofluoroacetate | chloro-fluoro-acetic acid butyl ester | BUTYLCHLOROFLUOROACETATE |
Shipped In | Normal |
---|
Names and Identifiers
IUPAC Name | butyl 2-chloro-2-fluoroacetate |
INCHI | InChI=1S/C6H10ClFO2/c1-2-3-4-10-6(9)5(7)8/h5H,2-4H2,1H3 |
InChi Key | KXGUVXPIYLHEBH-UHFFFAOYSA-N |
Canonical SMILES | CCCCOC(=O)C(F)Cl |
Isomeric SMILES | CCCCOC(=O)C(F)Cl |
PubChem CID | 2773443 |
Molecular Weight | 168.59 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator