| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| C347204-2mg | 2mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $356.90 |
| Synonyms | Caffeic acid 3-glucoside|24959-81-7|(E)-3-[4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoic acid|Caffeic acid 3-beta-D-glucoside|C10431|AC1NQZ0T|Caffeic Acid 3-|A-D-Glucoside|Caffeic acid O-glucoside|CHEBI:3 |
|---|---|
| Storage Temp | Store at -20°C |
| Shipped In | Ice chest + Ice pads |
| IUPAC Name | (E)-3-[4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoic acid |
|---|---|
| INCHI | InChI=1S/C15H18O9/c16-6-10-12(20)13(21)14(22)15(24-10)23-9-5-7(1-3-8(9)17)2-4-11(18)19/h1-5,10,12-17,20-22H,6H2,(H,18,19)/b4-2+/t10-,12-,13+,14-,15-/m1/s1 |
| InChi Key | QOPSZFXPZWQLOG-VHCZEJTMSA-N |
| Canonical SMILES | C1=CC(=C(C=C1C=CC(=O)O)OC2C(C(C(C(O2)CO)O)O)O)O |
| Isomeric SMILES | C1=CC(=C(C=C1/C=C/C(=O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O |
| PubChem CID | 5281759 |
| Molecular Weight | 342.3 |
Enter Lot Number to search for COA:
