| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| C288767-5mg | 5mg | In stock | $59.90 | |
| C288767-25mg | 25mg | In stock | $235.90 | |
| C288767-100mg | 100mg | In stock | $848.90 |
GPR27 agonist
| Specifications & Purity | ≥98% |
|---|---|
| Biochemical and Physiological Mechanisms | GPR27 agonist. Promotes recruitment of β-arrestin 2 to chimeric GPR27V2and wild-type GPR27 in a firefly luciferase complementation assay (pEC50values are 6.34 and 5.1, respectively). |
| Storage Temp | Store at 2-8°C |
| Shipped In | Wet ice |
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | 2,4-dichloro-N-[4-(phenylcarbamoyl)phenyl]benzamide |
|---|---|
| INCHI | InChI=1S/C20H14Cl2N2O2/c21-14-8-11-17(18(22)12-14)20(26)24-16-9-6-13(7-10-16)19(25)23-15-4-2-1-3-5-15/h1-12H,(H,23,25)(H,24,26) |
| InChi Key | PFHDXBXPRBQVAV-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)NC(=O)C2=CC=C(C=C2)NC(=O)C3=C(C=C(C=C3)Cl)Cl |
| Isomeric SMILES | C1=CC=C(C=C1)NC(=O)C2=CC=C(C=C2)NC(=O)C3=C(C=C(C=C3)Cl)Cl |
| PubChem CID | 1375606 |
| Molecular Weight | 385.24 |
Enter Lot Number to search for COA:
| Solubility | Solvent:DMSO, Max Conc. mg/mL: 38.52, Max Conc. mM: 100 |
|---|
| RIDADR | NONHforallmodesoftransport |
|---|
H2206495