| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| C337258-25mg | 25mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $190.90 |
| Synonyms | 75567-73-6|[[(2R)-2-[(1R)-1-(4-Amino-2-oxopyrimidin-1-yl)-2-oxoethoxy]-3-oxopropoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate|DTXSID20585102|(R)-2-((R)-1-(4-Amino-2-oxopyrimidin-1(2H)-yl)-2-oxoethoxy)-3-oxopropyl tetrahydrogen triphosphate |
|---|---|
| Storage Temp | Store at -20°C |
| Shipped In | Ice chest + Ice pads |
| IUPAC Name | [[(2R)-2-[(1R)-1-(4-amino-2-oxopyrimidin-1-yl)-2-oxoethoxy]-3-oxopropoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| INCHI | InChI=1S/C9H14N3O14P3/c10-7-1-2-12(9(15)11-7)8(4-14)24-6(3-13)5-23-28(19,20)26-29(21,22)25-27(16,17)18/h1-4,6,8H,5H2,(H,19,20)(H,21,22)(H2,10,11,15)(H2,16,17,18)/t6-,8+/m0/s1 |
| InChi Key | PAUXEDHSTJAGST-POYBYMJQSA-N |
| Canonical SMILES | C1=CN(C(=O)N=C1N)C(C=O)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C=O |
| Isomeric SMILES | C1=CN(C(=O)N=C1N)[C@@H](C=O)O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C=O |
| PubChem CID | 16219131 |
| Molecular Weight | 481.14 |
Enter Lot Number to search for COA:
