The store will not work correctly when cookies are disabled.
D-(-)-2-(2,5-Dihydrophenyl)glycine - ≥97.0%, high purity , CAS No.26774-88-9
Basic Description
| Synonyms | 26774-88-9|(R)-2-Amino-2-(cyclohexa-1,4-dien-1-yl)acetic acid|2,5-Dihydrophenylglycine, D-|(R)-(-)-2-(2,5-Dihydrophenyl)glycine|D-2,5-dihydrophenylglycine|Cyclohexa-1,4-dienylglycine|(2R)-2-amino-2-cyclohexa-1,4-dien-1-ylacetic acid|451NQ27TG5|(R)-2-amino |
|---|
| Specifications & Purity | ≥97% |
|---|
| Storage Temp | Store at 2-8°C |
|---|
| Shipped In | Wet ice |
|---|
Names and Identifiers
| Pubchem Sid | 488191770 |
|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488191770 |
|---|
| IUPAC Name | (2R)-2-amino-2-cyclohexa-1,4-dien-1-ylacetic acid |
|---|
| INCHI | InChI=1S/C8H11NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-2,5,7H,3-4,9H2,(H,10,11)/t7-/m1/s1 |
|---|
| InChi Key | JBJJTCGQCRGNOL-SSDOTTSWSA-N |
|---|
| Canonical SMILES | C1C=CCC(=C1)C(C(=O)O)N |
|---|
| Isomeric SMILES | C1C=CCC(=C1)[C@H](C(=O)O)N |
|---|
| WGK Germany | 3 |
|---|
| PubChem CID | 1268102 |
|---|
| Molecular Weight | 153.18 |
|---|
| Reaxy-Rn | 6194253 |
|---|
Chemical and Physical Properties
| Specific Rotation[α] | -155° (C=1,1mol/L HCl) |
|---|
Safety and Hazards(GHS)
| WGK Germany | 3 |
|---|
| Reaxy-Rn | 6194253 |
|---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator
G2203378