Basic Information
ID: ALA4407119
Type: Binding
Description: Inhibition of ATG4B (unknown origin) using N-(His)6-LC3B(L123C)Biotin as substrate preincubated for 30 mins and measured after 1 hr by AlphaScreen method
Organism: Homo sapiens
Activity Charts
Bioactivity
Activity Types for Assay ALA4407119
IC50
Compound Summary
| Parent Molecular Weight | ALogP | Polar Surface Area |
|---|---|---|
| 276.72 | 2.42 | 2.42 |
| 276.72 | 2.42 | 2.42 |
| 256.30 | 2.59 | 2.59 |
| 304.73 | 1.73 | 1.73 |
| 282.34 | 3.14 | 3.14 |
| 260.30 | 4.05 | 4.05 |
| 284.36 | 3.37 | 3.37 |
| 256.30 | 2.59 | 2.59 |
| 256.30 | 2.59 | 2.59 |
| 346.39 | 2.57 | 2.57 |
| 343.43 | 2.77 | 2.77 |
| 284.36 | 3.37 | 3.37 |
| 256.30 | 2.59 | 2.59 |
| 276.72 | 2.42 | 2.42 |
| 391.21 | 3.10 | 3.10 |