Basic Information
ID: ALA832584
Type: ADME
Description: Ratio of inhibition of human cytochrome P-450 2B6 to 2A6 was determined; Expressed as IC50(CYP2B6)/IC50(CYP2A6)
Organism: Homo sapiens
Activity Charts
Bioactivity
Activity Types for Assay ALA832584
Ratio
Compound Summary
| Parent Molecular Weight | ALogP | Polar Surface Area |
|---|---|---|
| 161.23 | 2.81 | 2.81 |
| 145.16 | 1.47 | 1.47 |
| 179.22 | 2.95 | 2.95 |
| 204.25 | 2.62 | 2.62 |
| 188.19 | 2.15 | 2.15 |
| 188.19 | 2.15 | 2.15 |
| 175.26 | 3.12 | 3.12 |
| 193.25 | 3.26 | 3.26 |
| 156.19 | 2.14 | 2.14 |
| 160.20 | 0.90 | 0.90 |
| 173.22 | 1.97 | 1.97 |
| 235.29 | 2.99 | 2.99 |
| 159.19 | 1.58 | 1.58 |
| 159.19 | 1.58 | 1.58 |
| 189.24 | 2.62 | 2.62 |
| 203.27 | 3.01 | 3.01 |
| 566.78 | ||
| 190.27 | 2.27 | 2.27 |
| 363.51 | 5.22 | 5.22 |
| 174.20 | 1.80 | 1.80 |
| 161.23 | 2.81 | 2.81 |
| 175.26 | 3.12 | 3.12 |
| 190.27 | 2.85 | 2.85 |
| 159.19 | 1.48 | 1.48 |
| 376.37 |