ID: ALA832584
Type: ADME
Description: Ratio of inhibition of human cytochrome P-450 2B6 to 2A6 was determined; Expressed as IC50(CYP2B6)/IC50(CYP2A6)
Organism: Homo sapiens
Bioactivity
Activity Types for Assay ALA832584
Ratio
Parent Molecular Weight | ALogP | Polar Surface Area |
---|---|---|
161.23 | 2.81 | 2.81 |
145.16 | 1.47 | 1.47 |
179.22 | 2.95 | 2.95 |
204.25 | 2.62 | 2.62 |
188.19 | 2.15 | 2.15 |
188.19 | 2.15 | 2.15 |
175.26 | 3.12 | 3.12 |
193.25 | 3.26 | 3.26 |
156.19 | 2.14 | 2.14 |
160.20 | 0.90 | 0.90 |
173.22 | 1.97 | 1.97 |
235.29 | 2.99 | 2.99 |
159.19 | 1.58 | 1.58 |
159.19 | 1.58 | 1.58 |
189.24 | 2.62 | 2.62 |
203.27 | 3.01 | 3.01 |
566.78 | ||
190.27 | 2.27 | 2.27 |
363.51 | 5.22 | 5.22 |
174.20 | 1.80 | 1.80 |
161.23 | 2.81 | 2.81 |
175.26 | 3.12 | 3.12 |
190.27 | 2.85 | 2.85 |
159.19 | 1.48 | 1.48 |
376.37 |