7-Aziridin-1-yl-2-naphthalen-2-yl-quinoline-5,8-dione

ID: ALA105857

PubChem CID: 44335333

Max Phase: Preclinical

Molecular Formula: C21H14N2O2

Molecular Weight: 326.36

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1C=C(N2CC2)C(=O)c2nc(-c3ccc4ccccc4c3)ccc21

Standard InChI:  InChI=1S/C21H14N2O2/c24-19-12-18(23-9-10-23)21(25)20-16(19)7-8-17(22-20)15-6-5-13-3-1-2-4-14(13)11-15/h1-8,11-12H,9-10H2

Standard InChI Key:  PKUDHALWINNSOO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 29  0  0  0  0  0  0  0  0999 V2000
   -0.9458    0.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4792    0.7458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2333    0.3333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6583    0.3250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9458    1.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1917    0.3333    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4792    1.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2333    1.9833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0458   -0.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4833    0.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9042    0.7458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6167    0.3333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1875    1.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3292    0.7458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2333   -0.4917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0417    0.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2333    2.8083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9000    1.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6167   -0.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0417   -0.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3292   -0.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7542    0.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7625   -0.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4667    0.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4792   -0.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  1  1  0
  4  1  1  0
  5  1  2  0
  6  2  1  0
  7  8  1  0
  8  5  1  0
  9  4  1  0
 10  4  1  0
 11  6  2  0
 12 11  1  0
 13  7  1  0
 14 12  1  0
 15  3  2  0
 16 14  2  0
 17  8  2  0
 18 13  2  0
 19 12  2  0
 20 21  2  0
 21 19  1  0
 22 16  1  0
 23 20  1  0
 24 22  2  0
 25 23  2  0
 10  9  1  0
  2  7  2  0
 18 11  1  0
 20 16  1  0
 25 24  1  0
M  END

Alternative Forms

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 326.36Molecular Weight (Monoisotopic): 326.1055AlogP: 3.48#Rotatable Bonds: 2
Polar Surface Area: 50.04Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.91CX LogP: 3.17CX LogD: 3.17
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.68Np Likeness Score: -0.11

References

1. Hargreaves R, David CL, Whitesell L, Skibo EB..  (2003)  Design of quinolinedione-based geldanamycin analogues.,  13  (18): [PMID:12941337] [10.1016/s0960-894x(03)00650-4]

Source