Analogue W

ID: ALA1159782

PubChem CID: 44273315

Max Phase: Preclinical

Molecular Formula: C19H39N5O9

Molecular Weight: 481.55

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NCCC1C(CO)OC(OC2C(O)C(N)CC(N)C2OC2OC(CN)C(O)C(O)C2N)C1O

Standard InChI:  InChI=1S/C19H39N5O9/c20-2-1-6-10(5-25)31-19(12(6)26)33-17-13(27)7(22)3-8(23)16(17)32-18-11(24)15(29)14(28)9(4-21)30-18/h6-19,25-29H,1-5,20-24H2

Standard InChI Key:  ZWMWMFQYDLHNHO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
    5.2917   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6417   -0.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0125   -0.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8792   -1.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2917   -3.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0917   -0.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2792   -2.1792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2375    0.1208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0542   -1.3292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2292   -3.0667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2125   -1.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6792    0.0083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3625   -0.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8917   -4.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5667   -4.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8417   -1.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5625   -1.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1667   -3.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4375   -1.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0042   -1.2042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6667   -1.9417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9417    1.1958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8417   -6.4542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2667   -0.7042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5542   -0.7292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2042   -2.5417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0417    0.5333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3542    0.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8875   -5.2292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5667   -5.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1667   -2.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3667   -2.5417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8500   -5.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  9  1  0
  3  2  1  0
  4  1  1  0
  5  7  1  0
  6  3  1  0
  7  1  1  0
  8  2  1  0
  9  4  1  0
 10  5  1  0
 11  1  1  0
 12 13  1  0
 13  8  1  0
 14  5  1  0
 15 14  1  0
 16 11  1  0
 17  4  1  0
 18 10  1  0
 19 16  1  0
 20  3  1  0
 21 16  1  0
 22 28  1  0
 23 33  1  0
 24  6  1  0
 25 17  1  0
 26 11  1  0
 27 12  1  0
 28 13  1  0
 29 14  1  0
 30 15  1  0
 31 18  1  0
 32 31  1  0
 33 30  1  0
 19 17  1  0
 18 15  1  0
 12  6  1  0
M  END

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 481.55Molecular Weight (Monoisotopic): 481.2748AlogP: -6.05#Rotatable Bonds: 8
Polar Surface Area: 268.17Molecular Species: BASEHBA: 14HBD: 10
#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 15#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.64CX Basic pKa: 10.07CX LogP: -6.36CX LogD: -13.59
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.15Np Likeness Score: 1.58

References

1. Cashman DJ, Rife JP, Kellogg GE..  (2001)  Which aminoglycoside ring is most important for binding? A hydropathic analysis of gentamicin, paromomycin, and analogues.,  11  (2): [PMID:11206440] [10.1016/s0960-894x(00)00615-6]

Source