2',3-Diamino-1-N-[(S)-4-amino-2-hydroxybutanoyl]-6'-(R)-methyl-paromamine

ID: ALA1164126

PubChem CID: 46907085

Max Phase: Preclinical

Molecular Formula: C17H34N4O9

Molecular Weight: 438.48

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  C[C@H](O)[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=O)[C@@H](O)CCN)C[C@@H]2N)[C@H](N)[C@@H](O)[C@@H]1O

Standard InChI:  InChI=1S/C17H34N4O9/c1-5(22)14-13(27)11(25)9(20)17(29-14)30-15-6(19)4-7(10(24)12(15)26)21-16(28)8(23)2-3-18/h5-15,17,22-27H,2-4,18-20H2,1H3,(H,21,28)/t5-,6-,7+,8-,9+,10-,11+,12+,13-,14+,15+,17+/m0/s1

Standard InChI Key:  NXUOYTJYPQGQII-TUTHOEKRSA-N

Molfile:  

     RDKit          2D

 32 33  0  0  0  0  0  0  0  0999 V2000
   10.9223  -24.5713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9214  -25.3963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6374  -25.8076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3475  -25.3976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3501  -24.5715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6323  -24.1544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0666  -24.1579    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6366  -26.6325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2072  -25.8182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4910  -25.4029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4939  -24.5745    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7818  -24.1628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0620  -24.5766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0629  -25.4016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7834  -25.8203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7803  -23.3346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1982  -24.9808    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.0669  -22.9193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4903  -23.7377    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.7821  -24.5710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4963  -24.1591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7824  -25.3942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2107  -24.5704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9249  -24.1585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0662  -25.8143    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2069  -24.1620    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7839  -26.6453    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3473  -25.8168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3480  -24.1609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4980  -22.9189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4959  -23.3359    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6351  -24.5698    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 10 11  1  0
 10 15  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 12 16  1  0
 10 17  1  1
 16 18  1  6
 12 19  1  6
  7 20  1  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 23 24  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  1
  3  8  1  1
  2  9  1  6
  9 10  1  0
 14 28  1  1
  1 26  1  1
 13 29  1  6
  4 25  1  6
 16 30  1  0
 15 27  1  6
 21 31  1  1
 24 32  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA1164126

   (2S)-4-amino-N-[(1R,2S,3R,4R,5S)-5-amino-4-[(2S,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-[(1S)-1-hydroxyethyl]oxan-2-yl]oxy-2,3-dihydroxycyclohexyl]-2-hydroxybutanamide

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 438.48

Molecular Weight (Monoisotopic): 438.2326

AlogP: -5.83

#Rotatable Bonds: 7

Polar Surface Area: 247.00

Molecular Species: BASE

HBA: 12

HBD: 10

#RO5 Violations: 2

HBA (Lipinski): 13

HBD (Lipinski): 13

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 12.40

CX Basic pKa: 9.61

CX LogP: -6.29

CX LogD: -10.50

Aromatic Rings: ┄

Heavy Atoms: 30

QED Weighted: 0.18

Np Likeness Score: 1.84

References

1. Nudelman I, Glikin D, Smolkin B, Hainrichson M, Belakhov V, Baasov T..  (2010)  Repairing faulty genes by aminoglycosides: development of new derivatives of geneticin (G418) with enhanced suppression of diseases-causing nonsense mutations.,  18  (11): [PMID:20409719] [10.1016/j.bmc.2010.03.060]

Source

Source(1):

• Scientific Literature