Anthopogochromene A

ID: ALA1171259

PubChem CID: 46872461

Max Phase: Preclinical

Molecular Formula: C23H30O5

Molecular Weight: 386.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C/C(=C\CC[C@@]1(C)C=Cc2c(cc(C)c(C(=O)O)c2O)O1)CC(=O)CC(C)C

Standard InChI:  InChI=1S/C23H30O5/c1-14(2)11-17(24)12-15(3)7-6-9-23(5)10-8-18-19(28-23)13-16(4)20(21(18)25)22(26)27/h7-8,10,13-14,25H,6,9,11-12H2,1-5H3,(H,26,27)/b15-7+/t23-/m0/s1

Standard InChI Key:  JWCJVZVWTGSSPQ-KETROQBRSA-N

Molfile:  

     RDKit          2D

 28 29  0  0  0  0  0  0  0  0999 V2000
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2928    2.6973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6486   -1.3517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9091    1.5019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9494    0.9039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9072    2.7019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5565   -2.2286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6170   -0.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2571   -2.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2568   -4.4805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0426   -5.2315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0428   -6.7323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0819   -4.6316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3422   -7.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3425   -8.9842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3816   -6.8835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6419   -9.7352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6421  -10.9352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6812   -9.1353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
 13 14  1  0
 13 15  2  0
  1 13  1  0
  5  4  2  0
  8 16  1  0
  4  1  1  0
  8 17  1  1
  5 10  1  0
 16 18  1  0
  6  7  1  0
 18 19  1  0
  7  8  1  0
 19 20  2  0
  8  9  1  0
 20 21  1  0
  9 10  2  0
 20 22  1  0
  5  6  1  0
 21 23  1  0
  4 11  1  0
 23 24  1  0
 23 25  2  0
  2 12  1  0
 24 26  1  0
  2  3  1  0
 26 27  1  0
  3  6  2  0
 26 28  1  0
M  END

Alternative Forms

  1. Parent:

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 386.49Molecular Weight (Monoisotopic): 386.2093AlogP: 5.29#Rotatable Bonds: 8
Polar Surface Area: 83.83Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 2.91CX Basic pKa: CX LogP: 6.02CX LogD: 2.53
Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.59Np Likeness Score: 2.84

References

1. Iwata N, Kitanaka S..  (2010)  Tetracyclic chromane derivatives from Rhododendron anthopogonoides.,  73  (7): [PMID:20586436] [10.1021/np900543r]

Source