N-([7-N,N-diethylaminocoumarin-4-yl]methyloxycarbonyl)anisomycin

ID: ALA1631692

PubChem CID: 53321107

Max Phase: Preclinical

Molecular Formula: C29H34N2O8

Molecular Weight: 538.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN(CC)c1ccc2c(COC(=O)N3C[C@@H](O)[C@H](OC(C)=O)[C@@H]3Cc3ccc(OC)cc3)cc(=O)oc2c1

Standard InChI:  InChI=1S/C29H34N2O8/c1-5-30(6-2)21-9-12-23-20(14-27(34)39-26(23)15-21)17-37-29(35)31-16-25(33)28(38-18(3)32)24(31)13-19-7-10-22(36-4)11-8-19/h7-12,14-15,24-25,28,33H,5-6,13,16-17H2,1-4H3/t24-,25+,28+/m0/s1

Standard InChI Key:  VSUXLBGXTZPJIH-BXTSTYNKSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
    1.8500    0.1459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6754    0.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9316   -0.6388    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2625   -1.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5974   -0.6383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3642    0.8127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8127   -0.8929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0905    0.8592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9155    0.8562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3227    0.1381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1470    0.1347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5629    0.8482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1487    1.5665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3258    1.5664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3879    0.8462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7987    0.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6477   -1.0485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6509   -1.8734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3605   -0.6331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9381   -2.2888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9413   -3.1138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9402   -4.7591    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6549   -4.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6553   -3.5173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2260   -4.3455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2269   -3.5251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5180   -3.1158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8076   -3.5258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8106   -4.3494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5201   -4.7550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0978   -4.7648    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6183   -4.3551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1011   -5.5898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6216   -3.5301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6117   -6.0051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3696   -4.7571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5438    0.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0580    1.3922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2092   -0.0287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 17 19  2  0
  4  5  1  0
 18 20  1  0
  9 10  2  0
 20 21  1  0
 21 26  1  0
  5  1  1  0
 10 11  1  0
  1  2  1  0
 21 24  2  0
 25 22  1  0
 22 23  1  0
 23 24  1  0
 11 12  2  0
  1  6  1  6
 25 26  2  0
 12 13  1  0
 26 27  1  0
 27 28  2  0
 13 14  2  0
 28 29  1  0
 14  9  1  0
 29 30  2  0
 30 25  1  0
  5  7  1  1
 29 31  1  0
 12 15  1  0
 31 32  1  0
  2  3  1  0
 31 33  1  0
 15 16  1  0
 32 34  1  0
  2  8  1  6
 33 35  1  0
  3 17  1  0
 23 36  2  0
  3  4  1  0
  6 37  1  0
 17 18  1  0
 37 38  2  0
  8  9  1  0
 37 39  1  0
M  END

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 538.60Molecular Weight (Monoisotopic): 538.2315AlogP: 3.50#Rotatable Bonds: 9
Polar Surface Area: 118.75Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.73CX Basic pKa: 4.12CX LogP: 3.10CX LogD: 3.10
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.32Np Likeness Score: 0.03

References

1. Sadovski O, Jaikaran AS, Samanta S, Fabian MR, Dowling RJ, Sonenberg N, Woolley GA..  (2010)  A collection of caged compounds for probing roles of local translation in neurobiology.,  18  (22): [PMID:20427189] [10.1016/j.bmc.2010.04.005]

Source