The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-([7-N,N-diethylaminocoumarin-4-yl]methyloxycarbonyl)anisomycin ID: ALA1631692
PubChem CID: 53321107
Max Phase: Preclinical
Molecular Formula: C29H34N2O8
Molecular Weight: 538.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)c1ccc2c(COC(=O)N3C[C@@H](O)[C@H](OC(C)=O)[C@@H]3Cc3ccc(OC)cc3)cc(=O)oc2c1
Standard InChI: InChI=1S/C29H34N2O8/c1-5-30(6-2)21-9-12-23-20(14-27(34)39-26(23)15-21)17-37-29(35)31-16-25(33)28(38-18(3)32)24(31)13-19-7-10-22(36-4)11-8-19/h7-12,14-15,24-25,28,33H,5-6,13,16-17H2,1-4H3/t24-,25+,28+/m0/s1
Standard InChI Key: VSUXLBGXTZPJIH-BXTSTYNKSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
1.8500 0.1459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6754 0.1463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9316 -0.6388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2625 -1.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5974 -0.6383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3642 0.8127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8127 -0.8929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0905 0.8592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9155 0.8562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3227 0.1381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1470 0.1347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5629 0.8482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1487 1.5665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3258 1.5664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3879 0.8462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7987 0.1308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6477 -1.0485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6509 -1.8734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3605 -0.6331 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9381 -2.2888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9413 -3.1138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9402 -4.7591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6549 -4.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6553 -3.5173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2260 -4.3455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2269 -3.5251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5180 -3.1158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8076 -3.5258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8106 -4.3494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5201 -4.7550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0978 -4.7648 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6183 -4.3551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1011 -5.5898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6216 -3.5301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6117 -6.0051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3696 -4.7571 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5438 0.7254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0580 1.3922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2092 -0.0287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17 19 2 0
4 5 1 0
18 20 1 0
9 10 2 0
20 21 1 0
21 26 1 0
5 1 1 0
10 11 1 0
1 2 1 0
21 24 2 0
25 22 1 0
22 23 1 0
23 24 1 0
11 12 2 0
1 6 1 6
25 26 2 0
12 13 1 0
26 27 1 0
27 28 2 0
13 14 2 0
28 29 1 0
14 9 1 0
29 30 2 0
30 25 1 0
5 7 1 1
29 31 1 0
12 15 1 0
31 32 1 0
2 3 1 0
31 33 1 0
15 16 1 0
32 34 1 0
2 8 1 6
33 35 1 0
3 17 1 0
23 36 2 0
3 4 1 0
6 37 1 0
17 18 1 0
37 38 2 0
8 9 1 0
37 39 1 0
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.60Molecular Weight (Monoisotopic): 538.2315AlogP: 3.50#Rotatable Bonds: 9Polar Surface Area: 118.75Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.73CX Basic pKa: 4.12CX LogP: 3.10CX LogD: 3.10Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.32Np Likeness Score: 0.03
References 1. Sadovski O, Jaikaran AS, Samanta S, Fabian MR, Dowling RJ, Sonenberg N, Woolley GA.. (2010) A collection of caged compounds for probing roles of local translation in neurobiology., 18 (22): [PMID:20427189 ] [10.1016/j.bmc.2010.04.005 ]