5,6-Dichloro-1-pentafluorophenylmethyl-2-piperidin-4-yl-1H-benzoimidazole

ID: ALA163487

PubChem CID: 44375263

Max Phase: Preclinical

Molecular Formula: C19H14Cl2F5N3

Molecular Weight: 450.24

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Fc1c(F)c(F)c(Cn2c(C3CCNCC3)nc3cc(Cl)c(Cl)cc32)c(F)c1F

Standard InChI:  InChI=1S/C19H14Cl2F5N3/c20-10-5-12-13(6-11(10)21)29(19(28-12)8-1-3-27-4-2-8)7-9-14(22)16(24)18(26)17(25)15(9)23/h5-6,8,27H,1-4,7H2

Standard InChI Key:  YJWBHCCDYIDBAY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    5.4375   -2.2375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6917   -3.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9250   -1.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4292   -0.9000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6500   -1.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6500   -1.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6917   -5.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9750   -5.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4125   -5.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9792   -4.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4042   -4.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7000   -3.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9292   -2.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9292   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2167   -1.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2167   -1.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7417   -1.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3917   -1.5542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6917   -6.3167    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.1250   -5.4917    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.2625   -5.4917    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.1167   -3.8375    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.2625   -3.8417    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.5000   -2.4042    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.5042   -0.7542    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.9792   -2.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9750   -0.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1625   -2.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1500   -0.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2 12  1  0
  3  1  1  0
  4  3  2  0
  5  1  1  0
  6  5  1  0
  7  9  2  0
  8 10  2  0
  9 11  1  0
 10  2  1  0
 11  2  2  0
 12  1  1  0
 13  5  2  0
 14  6  2  0
 15 13  1  0
 16 15  2  0
 17  3  1  0
 18 27  1  0
 19  7  1  0
 20  9  1  0
 21  8  1  0
 22 11  1  0
 23 10  1  0
 24 15  1  0
 25 16  1  0
 26 28  1  0
 27 29  1  0
 28 17  1  0
 29 17  1  0
  6  4  1  0
  7  8  1  0
 16 14  1  0
 18 26  1  0
M  END

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.24Molecular Weight (Monoisotopic): 449.0485AlogP: 5.55#Rotatable Bonds: 3
Polar Surface Area: 29.85Molecular Species: BASEHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.01CX LogP: 5.36CX LogD: 2.84
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.32Np Likeness Score: -0.97

References

1. He Y, Yang J, Wu B, Robinson D, Sprankle K, Kung PP, Lowery K, Mohan V, Hofstadler S, Swayze EE, Griffey R..  (2004)  Synthesis and evaluation of novel bacterial rRNA-binding benzimidazoles by mass spectrometry.,  14  (3): [PMID:14741271] [10.1016/j.bmcl.2003.11.031]

Source