Phenyl-carbamic acid 4-(4-amino-5-methoxy-6-methyl-tetrahydro-pyran-2-yloxy)-2,5,12-trihydroxy-6,11-dioxo-1,2,3,4,6,11-hexahydro-naphthacen-2-ylmethyl ester hydrochloride

ID: ALA2093888

PubChem CID: 70682912

Max Phase: Preclinical

Molecular Formula: C32H33ClN2O10

Molecular Weight: 604.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H]1O[C@@H](O[C@H]2C[C@](O)(COC(=O)Nc3ccccc3)Cc3c(O)c4c(c(O)c32)C(=O)c2ccccc2C4=O)C[C@@H](N)[C@H]1O.Cl

Standard InChI:  InChI=1S/C32H32N2O10.ClH/c1-15-26(35)20(33)11-22(43-15)44-21-13-32(41,14-42-31(40)34-16-7-3-2-4-8-16)12-19-23(21)30(39)25-24(29(19)38)27(36)17-9-5-6-10-18(17)28(25)37;/h2-10,15,20-22,26,35,38-39,41H,11-14,33H2,1H3,(H,34,40);1H/t15-,20+,21-,22-,26-,32-;/m0./s1

Standard InChI Key:  PWHSFUWPQHVAMF-DZVUHAJBSA-N

Molfile:  

     RDKit          2D

 45 49  0  0  0  0  0  0  0  0999 V2000
    4.7875   -0.5880    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.3349    0.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3349   -0.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0488   -1.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0488    0.5464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0841   -0.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0841    0.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3790    0.5464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3790   -1.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5118    0.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7627   -0.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7627    0.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7980   -1.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7980    0.5464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5100   -2.3505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5095   -3.1755    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5118   -0.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2247   -1.9385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9384   -3.1764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9389   -2.3515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2237   -3.5885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7963   -1.9359    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4960    0.9372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0488    1.2064    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0488   -1.6605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3808    1.2064    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3805   -1.6605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0730   -0.2240    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6147   -1.9107    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7090   -3.5733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4766   -1.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4766    0.5464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0904   -4.5142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0695    1.2639    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1905    0.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1905   -0.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0742    2.0889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7911    2.4973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3622    2.5055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7958    3.3223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5127    3.7306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5175    4.5556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8054    4.9722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0885    4.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0837    3.7389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  2  5  1  0
  6  7  1  0
  2  8  1  0
  7  8  2  0
  3  9  1  0
  6  9  2  0
  4 11  1  0
  5 12  1  0
 11 12  1  0
  6 13  1  0
  7 14  1  0
 10 14  1  0
 15 16  1  0
 10 17  1  0
 13 17  1  0
 15 18  1  0
 18 20  1  0
 19 20  1  0
 16 21  1  0
 19 21  1  0
 13 22  1  6
 15 22  1  1
 10 23  1  0
  5 24  2  0
  4 25  2  0
  8 26  1  0
  9 27  1  0
 10 28  1  6
 20 29  1  1
 19 30  1  1
 11 31  2  0
 12 32  2  0
 21 33  1  6
 23 34  1  0
 32 35  1  0
 31 36  1  0
 35 36  2  0
 34 37  1  0
 37 38  1  0
 37 39  2  0
 38 40  1  0
 40 41  1  0
 40 45  2  0
 41 42  2  0
 42 43  1  0
 43 44  2  0
 44 45  1  0
M  END

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 604.61Molecular Weight (Monoisotopic): 604.2057AlogP: 2.68#Rotatable Bonds: 5
Polar Surface Area: 197.87Molecular Species: BASEHBA: 11HBD: 6
#RO5 Violations: 3HBA (Lipinski): 12HBD (Lipinski): 7#RO5 Violations (Lipinski): 3
CX Acidic pKa: 8.03CX Basic pKa: 9.32CX LogP: 3.06CX LogD: 2.55
Aromatic Rings: 3Heavy Atoms: 44QED Weighted: 0.18Np Likeness Score: 1.00

References

1. Adams N, Blake C, Broadhurst MJ, Bushnell DJ, Hassall CH, Hartmann HR, Keech E, Stratton AR, Thomas GJ..  (1990)  Synthesis and antitumor activity of 9-[(carbamoyloxy)alkyl]anthracyclines: a novel class of anthracycline derivatives.,  33  (9): [PMID:2391682] [10.1021/jm00171a011]

Source