Phenyl-carbamic acid 4-(4-amino-5-hydroxy-6-methyl-tetrahydro-pyran-2-yloxy)-2,5,12-trihydroxy-6,11-dioxo-1,2,3,4,6,11-hexahydro-naphthacen-2-ylmethyl ester hydrochloride

ID: ALA2094053

PubChem CID: 70695540

Max Phase: Preclinical

Molecular Formula: C32H33ClN2O10

Molecular Weight: 604.61

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  C[C@@H]1O[C@@H](O[C@H]2C[C@](O)(COC(=O)Nc3ccccc3)Cc3c(O)c4c(c(O)c32)C(=O)c2ccccc2C4=O)C[C@@H](N)[C@@H]1O.Cl

Standard InChI:  InChI=1S/C32H32N2O10.ClH/c1-15-26(35)20(33)11-22(43-15)44-21-13-32(41,14-42-31(40)34-16-7-3-2-4-8-16)12-19-23(21)30(39)25-24(29(19)38)27(36)17-9-5-6-10-18(17)28(25)37;/h2-10,15,20-22,26,35,38-39,41H,11-14,33H2,1H3,(H,34,40);1H/t15-,20+,21-,22-,26+,32-;/m0./s1

Standard InChI Key:  PWHSFUWPQHVAMF-PKUNPCROSA-N

Molfile:  

     RDKit          2D

 45 49  0  0  0  0  0  0  0  0999 V2000
    5.5805   -0.4983    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -3.0723    1.2097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7868    1.6222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5013    1.2097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5013    0.3847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7868   -0.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0723    0.3847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3578    1.6222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6433    1.2097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6434    0.3847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3578   -0.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9289    1.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2144    1.2098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2144    0.3848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9289   -0.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5001    1.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2146    1.2098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2146    0.3848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5001   -0.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3578   -0.8528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3578    2.4472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9289   -0.8527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9289    2.4473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9291    1.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9291    0.7973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6435    1.2098    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3580    1.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0725    1.2098    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3580    2.4473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7869    1.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5014    1.2098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2159    1.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2159    2.4473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5014    2.8598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7869    2.4473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5001   -0.8527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2146   -1.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2146   -2.0902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9291   -2.5027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6435   -2.0902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6435   -1.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9290   -0.8527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9291   -3.3277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3580   -2.5027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3580   -0.8527    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
 11  7  1  0
  7  2  2  0
  2  8  1  0
  8  9  1  0
 10 11  1  0
  9 12  1  0
 10  9  2  0
 15 10  1  0
 12 13  2  0
 14 15  2  0
 13 16  1  0
 14 13  1  0
 19 14  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 11 20  2  0
  8 21  2  0
 15 22  1  0
 12 23  1  0
 17 24  1  0
 17 25  1  6
 24 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 28 30  1  0
 30 31  1  0
 30 35  2  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 19 36  1  6
 37 36  1  1
 37 38  1  0
 42 37  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 39 43  1  6
 40 44  1  6
 41 45  1  1
M  END

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 604.61

Molecular Weight (Monoisotopic): 604.2057

AlogP: 2.68

#Rotatable Bonds: 5

Polar Surface Area: 197.87

Molecular Species: BASE

HBA: 11

HBD: 6

#RO5 Violations: 3

HBA (Lipinski): 12

HBD (Lipinski): 7

#RO5 Violations (Lipinski): 3

CX Acidic pKa: 8.03

CX Basic pKa: 9.32

CX LogP: 3.06

CX LogD: 2.55

Aromatic Rings: 3

Heavy Atoms: 44

QED Weighted: 0.18

Np Likeness Score: 1.00

References

1. Adams N, Blake C, Broadhurst MJ, Bushnell DJ, Hassall CH, Hartmann HR, Keech E, Stratton AR, Thomas GJ..  (1990)  Synthesis and antitumor activity of 9-[(carbamoyloxy)alkyl]anthracyclines: a novel class of anthracycline derivatives.,  33  (9): [PMID:2391682] [10.1021/jm00171a011]

2. Adams N, Blake C, Broadhurst MJ, Bushnell DJ, Hassall CH, Hartmann HR, Keech E, Stratton AR, Thomas GJ..  (1990)  Synthesis and antitumor activity of 9-[(carbamoyloxy)alkyl]anthracyclines: a novel class of anthracycline derivatives.,  33  (9): [PMID:2391682] [10.1021/jm00171a011]

Source

Source(1):

• Scientific Literature