(6-Benzyloxy-7-methoxy-3,4-dihydro-isoquinolin-1-yl)-(3-hydroxy-phenyl)-methanone

ID: ALA2112019

PubChem CID: 11090306

Max Phase: Preclinical

Molecular Formula: C24H19NO4

Molecular Weight: 385.42

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc2c(C(=O)c3cccc(O)c3)nccc2cc1OCc1ccccc1

Standard InChI:  InChI=1S/C24H19NO4/c1-28-21-14-20-17(13-22(21)29-15-16-6-3-2-4-7-16)10-11-25-23(20)24(27)18-8-5-9-19(26)12-18/h2-14,26H,15H2,1H3

Standard InChI Key:  ZPJJSASBDJCNOM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    7.5478   -3.1961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8261   -2.7830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5478   -4.0222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1126   -3.1961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2613   -2.7788    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8261   -1.9569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2655   -4.4311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3991   -1.9569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3991   -2.7830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1126   -1.5438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6856   -1.5438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8344   -4.4353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2613   -5.2572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2530   -1.9444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9790   -5.6620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9679   -1.9569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6814   -3.1961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5395   -1.5396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2545   -1.5438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9790   -6.4881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9748   -4.0097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6883   -4.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6925   -5.2489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9679   -2.7830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5452   -1.9569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2587   -0.7177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5410   -0.3046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8275   -1.5521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8275   -0.7177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  2  2  0
  5  1  2  0
  6  2  1  0
  7  3  1  0
  8 10  1  0
  9  4  1  0
 10  6  2  0
 11  8  1  0
 12  3  2  0
 13  7  2  0
 14  5  1  0
 15 13  1  0
 16 11  1  0
 17  9  1  0
 18 14  2  0
 19 16  1  0
 20 15  1  0
 21  7  1  0
 22 21  2  0
 23 22  1  0
 24 17  1  0
 25 19  1  0
 26 19  2  0
 27 26  1  0
 28 25  2  0
 29 27  2  0
  6 18  1  0
  8  9  2  0
 23 15  2  0
 29 28  1  0
M  END

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 385.42Molecular Weight (Monoisotopic): 385.1314AlogP: 4.76#Rotatable Bonds: 6
Polar Surface Area: 68.65Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.82CX Basic pKa: 3.74CX LogP: 4.70CX LogD: 4.68
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.48Np Likeness Score: 0.06

References

1. Bermejo A, Andreu I, Suvire F, Léonce S, Caignard DH, Renard P, Pierré A, Enriz RD, Cortes D, Cabedo N..  (2002)  Syntheses and antitumor targeting G1 phase of the cell cycle of benzoyldihydroisoquinolines and related 1-substituted isoquinolines.,  45  (23): [PMID:12408717] [10.1021/jm020831a]

Source