(Z)-2-(4',6'-Dinitrophenyl)-1-(3,4,5-trimethoxyphenyl)ethene

ID: ALA2285722

PubChem CID: 76330938

Max Phase: Preclinical

Molecular Formula: C17H16N2O7

Molecular Weight: 360.32

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(/C=C\c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc(OC)c1OC

Standard InChI:  InChI=1S/C17H16N2O7/c1-24-15-8-11(9-16(25-2)17(15)26-3)4-5-12-6-7-13(18(20)21)10-14(12)19(22)23/h4-10H,1-3H3/b5-4-

Standard InChI Key:  DYBCGDZTUVOLPF-PLNGDYQASA-N

Molfile:  

     RDKit          2D

 26 27  0  0  0  0  0  0  0  0999 V2000
   18.2631  -19.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8545  -19.8534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0803  -19.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4889  -18.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3061  -18.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7147  -19.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3061  -19.8534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4889  -19.8534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7147  -20.5625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3061  -21.2675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5319  -19.1443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9405  -18.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7147  -17.7303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3061  -17.0212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2631  -20.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0803  -20.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4889  -21.2675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0803  -21.9765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2631  -21.9765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8545  -21.2674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0373  -21.2674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6287  -20.5625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6287  -21.9765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4889  -22.6856    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.3061  -22.6856    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0803  -23.3906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  3  8  2  0
  9 10  1  0
  7  9  1  0
 11 12  1  0
  6 11  1  0
 13 14  1  0
  5 13  1  0
  1  3  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 15 20  2  0
 21 22  2  0
 21 23  1  0
 20 21  1  0
 24 25  2  0
 24 26  1  0
 18 24  1  0
  2 15  1  0
M  CHG  4  21   1  23  -1  24   1  26  -1
M  END

Associated Targets(non-human)

Brontispa longissima (195 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 360.32Molecular Weight (Monoisotopic): 360.0958AlogP: 3.70#Rotatable Bonds: 7
Polar Surface Area: 113.97Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.72CX LogD: 3.72
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.42Np Likeness Score: -0.45

References

1. Liu Y, Li X, Zhao C, Lu Y, Li W, Liu Z, Feng G, Yang L.  (2013)  Synthesis and insect antifeedant activity of stilbene derivatives against Brontispa longissima Larvae,  22  (5): [10.1007/s00044-012-0212-x]

Source