(Z)-2-(4',6'-Dichlorophenyl)-1-(3,4,5-trimethoxyphenyl)ethene

ID: ALA2285723

PubChem CID: 59051934

Max Phase: Preclinical

Molecular Formula: C17H16Cl2O3

Molecular Weight: 339.22

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(/C=C\c2cc(Cl)cc(Cl)c2)cc(OC)c1OC

Standard InChI:  InChI=1S/C17H16Cl2O3/c1-20-15-8-12(9-16(21-2)17(15)22-3)5-4-11-6-13(18)10-14(19)7-11/h4-10H,1-3H3/b5-4-

Standard InChI Key:  JWCORGYYDPIQLE-PLNGDYQASA-N

Molfile:  

     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
    3.3226  -27.8293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1377  -27.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9366  -27.0982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0186  -27.2563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6213  -25.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4412  -25.7838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1896  -26.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5694  -27.1614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3753  -26.4087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5869  -27.9502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6396  -26.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8246  -26.5036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7718  -27.9242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8838  -28.5188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5188  -28.5786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1202  -27.0666    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3885  -27.2044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0696  -28.4837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0871  -29.2724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7412  -26.3398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3401  -28.6181    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.8352  -27.2874    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  1  1  0
  4 11  1  0
  5  7  1  0
  6  5  2  0
  7  9  1  0
  8  2  1  0
  9  3  2  0
 10 13  1  0
 11 12  2  0
 12  6  1  0
 13 17  2  0
 14  1  1  0
 15  2  1  0
 16  3  1  0
 17 12  1  0
 18 14  1  0
 19 15  1  0
 20 16  1  0
  8  7  2  0
 10  4  2  0
 13 21  1  0
  4 22  1  0
M  END

Associated Targets(non-human)

Brontispa longissima (195 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 339.22Molecular Weight (Monoisotopic): 338.0476AlogP: 5.19#Rotatable Bonds: 5
Polar Surface Area: 27.69Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.05CX LogD: 5.05
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.70Np Likeness Score: -0.14

References

1. Liu Y, Li X, Zhao C, Lu Y, Li W, Liu Z, Feng G, Yang L.  (2013)  Synthesis and insect antifeedant activity of stilbene derivatives against Brontispa longissima Larvae,  22  (5): [10.1007/s00044-012-0212-x]

Source