Osteoprotegerin

ID: ALA2397332

Cas Number: 19220-35-0

PubChem CID: 4378574

Max Phase: Preclinical

Molecular Formula: C18H32O2

Molecular Weight: 280.45

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCC#CCCCCCC(=O)O

Standard InChI:  InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-10,13-17H2,1H3,(H,19,20)

Standard InChI Key:  XXUPLYBCNPLTIW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 20 19  0  0  0  0  0  0  0  0999 V2000
   14.9406  -26.4844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6483  -26.0758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3560  -26.4844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0637  -26.0758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7714  -26.4844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4791  -26.0758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1868  -26.4844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8891  -26.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5973  -27.2967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2329  -26.0758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9406  -27.3016    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.3045  -26.8874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0127  -27.2952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7199  -26.8859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4281  -27.2937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1354  -26.8843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8435  -27.2922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5508  -26.8828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2589  -27.2907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9662  -26.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  3  0
  8  9  1  0
  1 10  1  0
  1 11  2  0
  9 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA2397332

    OSTEOPROTEGERIN

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 280.45Molecular Weight (Monoisotopic): 280.2402AlogP: 5.56#Rotatable Bonds: 13
Polar Surface Area: 37.30Molecular Species: ACIDHBA: 1HBD: 1
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.56CX Basic pKa: CX LogP: 6.73CX LogD: 3.97
Aromatic Rings: Heavy Atoms: 20QED Weighted: 0.35Np Likeness Score: 0.66

References

1. Marshall AJ, Lin JM, Grey A, Reid IR, Cornish J, Denny WA..  (2013)  Long-chain triazolyl acids as inhibitors of osteoclastogenesis.,  21  (14): [PMID:23726411] [10.1016/j.bmc.2013.05.013]

Source