The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
isoscutellarein 5-O-beta-D-glucopyranoside ID: ALA250694
PubChem CID: 5320057
Max Phase: Preclinical
Molecular Formula: C21H22O11
Molecular Weight: 450.40
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1CC(c2ccc(O)cc2)Oc2c(O)c(O)cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c21
Standard InChI: InChI=1S/C21H22O11/c22-7-14-17(27)18(28)19(29)21(32-14)31-13-6-11(25)16(26)20-15(13)10(24)5-12(30-20)8-1-3-9(23)4-2-8/h1-4,6,12,14,17-19,21-23,25-29H,5,7H2/t12?,14-,17-,18+,19-,21-/m1/s1
Standard InChI Key: YYSRTHIUABRSAB-UZWZRHDMSA-N
Molfile:
RDKit 2D
32 35 0 0 1 0 0 0 0 0999 V2000
-2.1878 1.3827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1890 0.5557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4746 0.1430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4764 1.7952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7613 1.3863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7625 0.5582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0499 0.1455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6685 0.5562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6696 1.3843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0476 1.8016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3828 1.7919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0963 1.3761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8109 1.7860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8133 2.6115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0952 3.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3835 2.6131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5279 3.0230 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0522 -0.6791 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9021 1.7948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4729 -0.6816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1861 -1.0953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8992 -0.6883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6102 -1.0985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6128 -1.9235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8981 -2.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1806 -1.9246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8992 -3.1611 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3237 -0.6850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3223 0.1396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3277 -2.3345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4657 -2.3354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4788 2.6198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15 16 2 0
16 11 1 0
9 11 1 0
4 1 1 0
14 17 1 0
5 10 1 0
7 18 2 0
6 7 1 0
1 19 1 0
7 8 1 0
3 20 1 0
8 9 1 0
21 20 1 1
21 22 1 0
9 10 1 0
5 6 1 0
11 12 2 0
2 3 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
12 13 1 0
25 27 1 1
3 6 2 0
23 28 1 1
13 14 2 0
28 29 1 0
1 2 2 0
24 30 1 6
14 15 1 0
26 31 1 6
5 4 2 0
4 32 1 0
M END Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.40Molecular Weight (Monoisotopic): 450.1162AlogP: -0.31#Rotatable Bonds: 4Polar Surface Area: 186.37Molecular Species: NEUTRALHBA: 11HBD: 7#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.97CX Basic pKa: ┄CX LogP: -0.39CX LogD: -0.49Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.30Np Likeness Score: 2.32
References 1. Yoon KD, Jeong DG, Hwang YH, Ryu JM, Kim J.. (2007) Inhibitors of osteoclast differentiation from Cephalotaxus koreana., 70 (12): [PMID:17994703 ] [10.1021/np070327e ]