isoscutellarein 5-O-beta-D-glucopyranoside

ID: ALA250694

PubChem CID: 5320057

Max Phase: Preclinical

Molecular Formula: C21H22O11

Molecular Weight: 450.40

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1CC(c2ccc(O)cc2)Oc2c(O)c(O)cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c21

Standard InChI:  InChI=1S/C21H22O11/c22-7-14-17(27)18(28)19(29)21(32-14)31-13-6-11(25)16(26)20-15(13)10(24)5-12(30-20)8-1-3-9(23)4-2-8/h1-4,6,12,14,17-19,21-23,25-29H,5,7H2/t12?,14-,17-,18+,19-,21-/m1/s1

Standard InChI Key:  YYSRTHIUABRSAB-UZWZRHDMSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  1  0  0  0  0  0999 V2000
   -2.1878    1.3827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1890    0.5557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4746    0.1430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4764    1.7952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7613    1.3863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7625    0.5582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0499    0.1455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6685    0.5562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6696    1.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0476    1.8016    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3828    1.7919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0963    1.3761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8109    1.7860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8133    2.6115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0952    3.0254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3835    2.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5279    3.0230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0522   -0.6791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9021    1.7948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4729   -0.6816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1861   -1.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8992   -0.6883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6102   -1.0985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6128   -1.9235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8981   -2.3365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1806   -1.9246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8992   -3.1611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3237   -0.6850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3223    0.1396    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3277   -2.3345    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4657   -2.3354    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4788    2.6198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 15 16  2  0
 16 11  1  0
  9 11  1  0
  4  1  1  0
 14 17  1  0
  5 10  1  0
  7 18  2  0
  6  7  1  0
  1 19  1  0
  7  8  1  0
  3 20  1  0
  8  9  1  0
 21 20  1  1
 21 22  1  0
  9 10  1  0
  5  6  1  0
 11 12  2  0
  2  3  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 12 13  1  0
 25 27  1  1
  3  6  2  0
 23 28  1  1
 13 14  2  0
 28 29  1  0
  1  2  2  0
 24 30  1  6
 14 15  1  0
 26 31  1  6
  5  4  2  0
  4 32  1  0
M  END

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 450.40Molecular Weight (Monoisotopic): 450.1162AlogP: -0.31#Rotatable Bonds: 4
Polar Surface Area: 186.37Molecular Species: NEUTRALHBA: 11HBD: 7
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 7#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.97CX Basic pKa: CX LogP: -0.39CX LogD: -0.49
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.30Np Likeness Score: 2.32

References

1. Yoon KD, Jeong DG, Hwang YH, Ryu JM, Kim J..  (2007)  Inhibitors of osteoclast differentiation from Cephalotaxus koreana.,  70  (12): [PMID:17994703] [10.1021/np070327e]

Source