2-(3-nitrobenzylthio)-5-(pyridin-4-yl)-1,3,4-oxadiazole

ID: ALA3125373

Cas Number: 604740-22-9

PubChem CID: 1467929

Max Phase: Preclinical

Molecular Formula: C14H10N4O3S

Molecular Weight: 314.33

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=[N+]([O-])c1cccc(CSc2nnc(-c3ccncc3)o2)c1

Standard InChI:  InChI=1S/C14H10N4O3S/c19-18(20)12-3-1-2-10(8-12)9-22-14-17-16-13(21-14)11-4-6-15-7-5-11/h1-8H,9H2

Standard InChI Key:  YMGCZTQTGNNWIG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
   25.0378  -14.2059    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.7755  -13.4229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4381  -12.9299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1124  -13.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8623  -14.1963    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0681  -12.9983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8381  -13.0163    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   23.3504  -13.4018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6429  -12.9774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6568  -12.1508    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.3839  -11.7506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0884  -12.1773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5422  -13.4477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2679  -13.0534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9690  -13.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6941  -13.0918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7162  -12.2654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0070  -11.8340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2847  -12.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4016  -13.5244    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.1275  -13.1306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.3797  -14.3499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  2  6  1  0
  4  7  1  0
  6  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  6  1  0
  7 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 20 21  2  0
 20 22  1  0
 16 20  1  0
M  CHG  2  20   1  22  -1
M  END

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 314.33Molecular Weight (Monoisotopic): 314.0474AlogP: 3.33#Rotatable Bonds: 5
Polar Surface Area: 94.95Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.48CX LogP: 2.63CX LogD: 2.63
Aromatic Rings: 3Heavy Atoms: 22QED Weighted: 0.40Np Likeness Score: -2.45

References

1. Lukas TJ, Schiltz GE, Arrat H, Scheidt K, Siddique T..  (2014)  Discovery of 1,3,4-oxidiazole scaffold compounds as inhibitors of superoxide dismutase expression.,  24  (6): [PMID:24560539] [10.1016/j.bmcl.2014.01.078]

Source