6-(3-(trifluoromethyl)phenyl)-1,2,4-triazine-3,5-diamine

ID: ALA3272972

PubChem CID: 604040

Max Phase: Preclinical

Molecular Formula: C10H8F3N5

Molecular Weight: 255.20

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1nnc(-c2cccc(C(F)(F)F)c2)c(N)n1

Standard InChI:  InChI=1S/C10H8F3N5/c11-10(12,13)6-3-1-2-5(4-6)7-8(14)16-9(15)18-17-7/h1-4H,(H4,14,15,16,18)

Standard InChI Key:  FZKGZZFECJJTJM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 18 19  0  0  0  0  0  0  0  0999 V2000
   15.6077   -4.0103    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4249   -4.0103    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8335   -4.7194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4249   -5.4244    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6077   -5.4244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1991   -4.7194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3819   -4.7194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9733   -5.4244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1561   -5.4244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7475   -4.7194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1561   -4.0103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9733   -4.0103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1991   -6.1335    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.6507   -4.7194    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7472   -3.3028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1555   -2.5949    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.9300   -3.3031    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.3322   -2.5919    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  1  6  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
  7 12  2  0
  6  7  1  0
  5 13  1  0
  3 14  1  0
 11 15  1  0
 15 16  1  0
 15 17  1  0
 15 18  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Plasmodium gallinaceum (527 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasmodium berghei (192651 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 255.20Molecular Weight (Monoisotopic): 255.0732AlogP: 1.72#Rotatable Bonds: 1
Polar Surface Area: 90.71Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.07CX LogP: 1.60CX LogD: 1.58
Aromatic Rings: 2Heavy Atoms: 18QED Weighted: 0.81Np Likeness Score: -1.37

References

1. March LC, Bajwa GS, Lee J, Wasti K, Joullíe MM..  (1976)  Antimalarials. 3. 1,2,4-Triazines.,  19  (6): [PMID:781244] [10.1021/jm00228a024]

Source