(1R,2S,3R,6R,8R,13S,14R,15R,16S,17R)-10,15,16-trihydroxy-9,13-dimethyl-3-[(3-methylbut-2-enoyl)oxy]-4,11-dioxo-5,18-dioxapentacyclo[12.5.0.0^{1,6}.0^{2,17}.0^{8,13}]nonadec-9-ene-17-carboxylic acid

ID: ALA3342216

PubChem CID: 10391474

Max Phase: Preclinical

Molecular Formula: C25H30O11

Molecular Weight: 506.50

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)=CC(=O)O[C@H]1C(=O)O[C@@H]2C[C@H]3C(C)=C(O)C(=O)C[C@]3(C)[C@H]3[C@@H](O)[C@H](O)[C@]4(C(=O)O)OC[C@]32[C@@H]14

Standard InChI:  InChI=1S/C25H30O11/c1-9(2)5-14(27)36-17-19-24-8-34-25(19,22(32)33)20(30)16(29)18(24)23(4)7-12(26)15(28)10(3)11(23)6-13(24)35-21(17)31/h5,11,13,16-20,28-30H,6-8H2,1-4H3,(H,32,33)/t11-,13+,16+,17+,18+,19+,20-,23-,24+,25+/m0/s1

Standard InChI Key:  RIYGDELXURVOBZ-HVCNMUSHSA-N

Molfile:  

     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
    3.4256   -3.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4256   -3.8177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1309   -4.2222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1309   -2.5878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8362   -3.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8372   -3.8177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5415   -4.2231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5394   -2.5887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9642   -1.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2557   -1.3645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5403   -1.7702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2479   -3.0033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2486   -3.8134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9466   -4.2156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6484   -3.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6477   -3.0021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9452   -2.5954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7185   -4.2273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7167   -2.5940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1306   -5.0393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3559   -4.2212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8344   -1.3585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2613   -0.5474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6777   -1.3808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3795   -1.7996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6896   -0.5637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3555   -2.5936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0631   -3.0023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7709   -2.5939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0630   -3.8195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5829   -2.2906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9927   -1.8242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8289   -2.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8330   -4.6308    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2404   -4.6266    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9379   -3.4091    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.5346   -3.4050    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.4786   -3.0026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4784   -3.8198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1863   -2.5941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2 18  1  0
  1 19  2  0
  3 20  1  0
 15 21  2  0
  1  4  1  0
 11 22  1  1
  2  3  2  0
 10 23  1  6
  3  6  1  0
  9 24  1  6
  5  4  1  0
 24 25  1  0
  5  6  1  0
 24 26  2  0
 16 27  1  1
 27 28  1  0
  5  8  1  0
 28 29  1  0
  6  7  1  0
 28 30  2  0
  7 13  1  0
  8 12  1  0
 12 31  1  1
  9 32  1  0
 32 31  1  0
  5 33  1  1
  8 11  1  0
  6 34  1  6
 17  9  1  0
 13 35  1  1
  9 10  1  0
 17 36  1  1
 10 11  1  0
  8 37  1  6
 12 13  1  0
  1  2  1  0
 12 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 29 38  2  0
 38 39  1  0
 38 40  1  0
M  END

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 506.50Molecular Weight (Monoisotopic): 506.1788AlogP: 0.43#Rotatable Bonds: 3
Polar Surface Area: 176.89Molecular Species: ACIDHBA: 10HBD: 4
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.46CX Basic pKa: CX LogP: 0.09CX LogD: -3.31
Aromatic Rings: Heavy Atoms: 36QED Weighted: 0.31Np Likeness Score: 3.67

References

1. Tang W, Xie J, Xu S, Lv H, Lin M, Yuan S, Bai J, Hou Q, Yu S..  (2014)  Novel nitric oxide-releasing derivatives of brusatol as anti-inflammatory agents: design, synthesis, biological evaluation, and nitric oxide release studies.,  57  (18): [PMID:25179783] [10.1021/jm5007534]

Source